The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8716296, 52 ID: ALA3694404
PubChem CID: 59509072
Max Phase: Preclinical
Molecular Formula: C20H20N4O4S
Molecular Weight: 412.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1-c1cc(NC(=O)c2ccc(C)c(NS(C)(=O)=O)c2)ncn1
Standard InChI: InChI=1S/C20H20N4O4S/c1-13-8-9-14(10-16(13)24-29(3,26)27)20(25)23-19-11-17(21-12-22-19)15-6-4-5-7-18(15)28-2/h4-12,24H,1-3H3,(H,21,22,23,25)
Standard InChI Key: VDRNYWRYYIDFSU-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
3.6387 -0.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2978 -3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2955 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5925 -6.0081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5879 -7.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5467 -8.1054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8849 -8.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8826 -9.7641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1804 -10.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4807 -9.7683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5190 -10.3700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4831 -8.2683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7825 -7.5173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.7828 -6.0165 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-8.8218 -5.4160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7435 -5.4166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7825 -4.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1853 -7.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0048 -6.0009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3026 -5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3002 -3.7488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 2 0
22 25 1 0
20 26 2 0
26 15 1 0
11 27 2 0
27 28 1 0
28 29 2 0
29 9 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.47Molecular Weight (Monoisotopic): 412.1205AlogP: 3.08#Rotatable Bonds: 6Polar Surface Area: 110.28Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.44CX Basic pKa: 0.99CX LogP: 2.50CX LogD: 2.49Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.64Np Likeness Score: -1.67
References 1. (2014) Inhibitors of protein kinases,