US8716296, 83

ID: ALA3694407

PubChem CID: 59509028

Max Phase: Preclinical

Molecular Formula: C18H15FN4O2

Molecular Weight: 338.34

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(F)cc1-c1cc(NC(=O)Cc2ccncc2)ncn1

Standard InChI:  InChI=1S/C18H15FN4O2/c1-25-16-3-2-13(19)9-14(16)15-10-17(22-11-21-15)23-18(24)8-12-4-6-20-7-5-12/h2-7,9-11H,8H2,1H3,(H,21,22,23,24)

Standard InChI Key:  ATJVINUVBZGFIF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    3.6387   -0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2978   -3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2955   -5.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5925   -6.0081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5879   -7.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5467   -8.1054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8849   -8.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8804   -9.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1756  -10.5215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1681  -12.0215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8653  -12.7649    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5700  -12.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5776  -10.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0048   -6.0009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3026   -5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3002   -3.7488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  6  8  1  0
  8  9  2  0
  9  3  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 12 23  2  0
 23 24  1  0
 24 25  2  0
 25 10  1  0
M  END

Associated Targets(Human)

CDK9 Tchem Cyclin-dependent kinase 9 (2495 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 338.34Molecular Weight (Monoisotopic): 338.1179AlogP: 2.87#Rotatable Bonds: 5
Polar Surface Area: 77.00Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.81CX Basic pKa: 5.04CX LogP: 2.52CX LogD: 2.51
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.77Np Likeness Score: -1.59

References

1.  (2014)  Inhibitors of protein kinases, 

Source

Source(1):