US8759537, 178

ID: ALA3694574

PubChem CID: 68052093

Max Phase: Preclinical

Molecular Formula: C30H31Cl3FN5O4

Molecular Weight: 650.97

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COCCOc1cc2c(cc1C(=O)Nc1ccc(F)c(Cl)c1)nc(Nc1c(Cl)ccc(CNC(=O)C(C)(C)C)c1Cl)n2C

Standard InChI:  InChI=1S/C30H31Cl3FN5O4/c1-30(2,3)28(41)35-15-16-6-8-19(31)26(25(16)33)38-29-37-22-13-18(24(43-11-10-42-5)14-23(22)39(29)4)27(40)36-17-7-9-21(34)20(32)12-17/h6-9,12-14H,10-11,15H2,1-5H3,(H,35,41)(H,36,40)(H,37,38)

Standard InChI Key:  BSWQRYVQBJBXAG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 43 46  0  0  0  0  0  0  0  0999 V2000
    7.5395   -1.3388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4990   -0.7409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0351   -3.6026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6060   -6.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6060   -7.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070   -8.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070   -9.4503    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0080   -7.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0312   -8.1004    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.0079   -6.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133    1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032    3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5551    4.4192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0559    4.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8105    5.7135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2142    6.7548    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -6.3105    5.7082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0560    4.4066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3015    3.1102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0500    1.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5508    1.8063    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2994    0.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6976   -0.5327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.8002    0.5024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.3987   -0.5377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.0002    0.5005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4020    1.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8015    3.1154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1979    2.0783    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.3115    2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4916    3.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
 20 22  2  0
 22 15  1  0
  9 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 34 36  1  0
 36 37  1  0
 36 38  1  0
 36 39  1  0
 31 40  2  0
 40 26  1  0
 40 41  1  0
 24 42  1  0
 42  8  1  0
 42 43  1  0
M  END

Associated Targets(Human)

PTGES Tchem Prostaglandin E synthase (3082 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 650.97Molecular Weight (Monoisotopic): 649.1426AlogP: 7.36#Rotatable Bonds: 10
Polar Surface Area: 106.51Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.54CX Basic pKa: 5.31CX LogP: 7.19CX LogD: 7.19
Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.15Np Likeness Score: -1.64

References

1.  (2014)  3H-imidazo [4, 5-C] pyridine-6-carboxamides as anti-inflammatory agents, 

Source

Source(1):