The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8969394, 6 ID: ALA3695938
PubChem CID: 24952579
Max Phase: Preclinical
Molecular Formula: C22H18Cl3NO3S
Molecular Weight: 482.82
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc([C@H](C)NC(=O)c2c(Cl)sc(Cl)c2Cc2cccc(Cl)c2)cc1
Standard InChI: InChI=1S/C22H18Cl3NO3S/c1-12(14-6-8-15(9-7-14)22(28)29-2)26-21(27)18-17(19(24)30-20(18)25)11-13-4-3-5-16(23)10-13/h3-10,12H,11H2,1-2H3,(H,26,27)/t12-/m0/s1
Standard InChI Key: SMQMCNFEOUIGIM-LBPRGKRZSA-N
Molfile:
RDKit 2D
30 32 0 0 1 0 0 0 0 0999 V2000
3.6331 -3.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5998 1.4987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6380 0.8969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6028 2.9995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9036 3.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9418 3.1464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9066 5.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1200 6.1089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2591 5.7313 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.6564 7.5354 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.1564 7.5353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4510 8.5061 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.6930 6.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2727 5.6318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9742 4.1609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4471 3.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7424 2.2107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3835 1.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8048 1.6991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7055 0.9062 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.1001 3.1697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
11 12 1 6
11 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
16 17 2 0
17 18 1 0
17 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
22 16 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 1 0
28 30 2 0
30 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.82Molecular Weight (Monoisotopic): 481.0073AlogP: 6.58#Rotatable Bonds: 6Polar Surface Area: 55.40Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.57CX Basic pKa: ┄CX LogP: 7.21CX LogD: 7.21Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.40Np Likeness Score: -0.97
References 1. (2015) Thiophenecarboxamide derivatives as EP4 receptor ligands,