The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8969394, 8 ID: ALA3695939
PubChem CID: 24952924
Max Phase: Preclinical
Molecular Formula: C26H24Cl3NO5S
Molecular Weight: 568.91
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](NC(=O)c1c(Cl)sc(Cl)c1C(OC1CCCCO1)c1cccc(Cl)c1)c1ccc(C(=O)O)cc1
Standard InChI: InChI=1S/C26H24Cl3NO5S/c1-14(15-8-10-16(11-9-15)26(32)33)30-25(31)21-20(23(28)36-24(21)29)22(17-5-4-6-18(27)13-17)35-19-7-2-3-12-34-19/h4-6,8-11,13-14,19,22H,2-3,7,12H2,1H3,(H,30,31)(H,32,33)/t14-,19?,22?/m0/s1
Standard InChI Key: UUZOSJJYPGRLFD-YGXOJQJDSA-N
Molfile:
RDKit 2D
36 39 0 0 1 0 0 0 0 0999 V2000
5.8528 1.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7151 0.7975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4174 -0.6735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5419 -1.6675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6796 -1.2859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2447 -3.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2484 -4.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4419 -4.1253 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.4984 -5.5497 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.0312 -5.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1347 -6.0355 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2941 -3.7520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0047 -3.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3041 -3.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3046 -5.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0059 -6.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0063 -7.2016 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.2935 -5.2521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5906 1.7915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1676 1.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0451 2.3119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3455 3.7815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7684 4.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8909 3.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2244 4.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4664 5.9547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9146 4.4016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 6
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 2 0
7 8 1 0
7 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
12 6 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 15 1 0
13 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
25 27 2 0
27 21 1 0
2 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
34 35 2 0
34 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 568.91Molecular Weight (Monoisotopic): 567.0441AlogP: 7.53#Rotatable Bonds: 8Polar Surface Area: 84.86Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.06CX Basic pKa: ┄CX LogP: 7.33CX LogD: 4.21Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -0.62
References 1. (2015) Thiophenecarboxamide derivatives as EP4 receptor ligands,