US8969394, 8

ID: ALA3695939

PubChem CID: 24952924

Max Phase: Preclinical

Molecular Formula: C26H24Cl3NO5S

Molecular Weight: 568.91

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](NC(=O)c1c(Cl)sc(Cl)c1C(OC1CCCCO1)c1cccc(Cl)c1)c1ccc(C(=O)O)cc1

Standard InChI:  InChI=1S/C26H24Cl3NO5S/c1-14(15-8-10-16(11-9-15)26(32)33)30-25(31)21-20(23(28)36-24(21)29)22(17-5-4-6-18(27)13-17)35-19-7-2-3-12-34-19/h4-6,8-11,13-14,19,22H,2-3,7,12H2,1H3,(H,30,31)(H,32,33)/t14-,19?,22?/m0/s1

Standard InChI Key:  UUZOSJJYPGRLFD-YGXOJQJDSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  1  0  0  0  0  0999 V2000
    5.8528    1.1791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7151    0.7975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4174   -0.6735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5419   -1.6675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6796   -1.2859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2447   -3.1359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2484   -4.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4419   -4.1253    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.4984   -5.5497    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.0312   -5.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1347   -6.0355    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2941   -3.7520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0047   -3.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3041   -3.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3046   -5.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0059   -6.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0063   -7.2016    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.2935   -5.2521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5906    1.7915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1676    1.3169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0451    2.3119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3455    3.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7684    4.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8909    3.2611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2244    4.7793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4664    5.9547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9146    4.4016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 12  6  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 15  1  0
 13 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 25 27  2  0
 27 21  1  0
  2 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 31 34  1  0
 34 35  2  0
 34 36  1  0
M  END

Associated Targets(Human)

PTGER4 Tclin Prostanoid EP4 receptor (2181 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 568.91Molecular Weight (Monoisotopic): 567.0441AlogP: 7.53#Rotatable Bonds: 8
Polar Surface Area: 84.86Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.06CX Basic pKa: CX LogP: 7.33CX LogD: 4.21
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -0.62

References

1.  (2015)  Thiophenecarboxamide derivatives as EP4 receptor ligands, 

Source

Source(1):