The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8969394, 26 ID: ALA3695945
PubChem CID: 24953627
Max Phase: Preclinical
Molecular Formula: C25H22F3N5OS
Molecular Weight: 497.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1sc(C)c(C(=O)NC2(c3ccc(-c4nn[nH]n4)cc3)CC2)c1Cc1cccc(C(F)(F)F)c1
Standard InChI: InChI=1S/C25H22F3N5OS/c1-14-20(13-16-4-3-5-19(12-16)25(26,27)28)21(15(2)35-14)23(34)29-24(10-11-24)18-8-6-17(7-9-18)22-30-32-33-31-22/h3-9,12H,10-11,13H2,1-2H3,(H,29,34)(H,30,31,32,33)
Standard InChI Key: CIEAOSWNZSOPSF-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
2.4245 -8.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1333 -7.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6333 -7.5469 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.1019 -6.1219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2422 -5.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8914 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8937 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9340 -3.1589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5955 -3.0038 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5978 -1.5030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2345 -0.2716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9823 -1.5719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7390 2.9810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2067 3.2905 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9546 1.9903 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9492 0.8772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6748 -6.1133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2543 -5.6373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1291 -6.6306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2939 -6.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4164 -7.1511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1159 -8.6207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6929 -9.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4295 -8.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3923 -10.5657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2898 -11.3623 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.7462 -10.9450 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.1514 -11.7412 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
4 6 2 0
6 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 10 1 0
10 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 19 2 0
6 24 1 0
24 2 2 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
30 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.55Molecular Weight (Monoisotopic): 497.1497AlogP: 5.57#Rotatable Bonds: 6Polar Surface Area: 83.56Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.92CX Basic pKa: ┄CX LogP: 6.97CX LogD: 5.74Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.39
References 1. (2015) Thiophenecarboxamide derivatives as EP4 receptor ligands,