US8969394, 26

ID: ALA3695945

PubChem CID: 24953627

Max Phase: Preclinical

Molecular Formula: C25H22F3N5OS

Molecular Weight: 497.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1sc(C)c(C(=O)NC2(c3ccc(-c4nn[nH]n4)cc3)CC2)c1Cc1cccc(C(F)(F)F)c1

Standard InChI:  InChI=1S/C25H22F3N5OS/c1-14-20(13-16-4-3-5-19(12-16)25(26,27)28)21(15(2)35-14)23(34)29-24(10-11-24)18-8-6-17(7-9-18)22-30-32-33-31-22/h3-9,12H,10-11,13H2,1-2H3,(H,29,34)(H,30,31,32,33)

Standard InChI Key:  CIEAOSWNZSOPSF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    2.4245   -8.5099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1333   -7.5415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6333   -7.5469    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.1019   -6.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2422   -5.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8914   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8937   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9340   -3.1589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5955   -3.0038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5978   -1.5030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2345   -0.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9823   -1.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7390    2.9810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2067    3.2905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9546    1.9903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9492    0.8772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6748   -6.1133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2543   -5.6373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1291   -6.6306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2939   -6.1561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4164   -7.1511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1159   -8.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6929   -9.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4295   -8.1003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3923  -10.5657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2898  -11.3623    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.7462  -10.9450    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1514  -11.7412    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 10  1  0
 10 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 16 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 19  2  0
  6 24  1  0
 24  2  2  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 30 32  1  0
 32 33  1  0
 32 34  1  0
 32 35  1  0
M  END

Associated Targets(Human)

PTGER4 Tclin Prostanoid EP4 receptor (2181 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.55Molecular Weight (Monoisotopic): 497.1497AlogP: 5.57#Rotatable Bonds: 6
Polar Surface Area: 83.56Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.92CX Basic pKa: CX LogP: 6.97CX LogD: 5.74
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.39

References

1.  (2015)  Thiophenecarboxamide derivatives as EP4 receptor ligands, 

Source

Source(1):