US9034866, 423

ID: ALA3696709

PubChem CID: 89755008

Max Phase: Preclinical

Molecular Formula: C28H25ClN4O4

Molecular Weight: 516.99

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CC[C@@](O)(C#Cc2ccc3c(c2)-c2nc(C(N)=O)c(COc4ccccc4Cl)n2C2CC3C2)C1=O

Standard InChI:  InChI=1S/C28H25ClN4O4/c1-32-11-10-28(36,27(32)35)9-8-16-6-7-19-17-13-18(14-17)33-22(15-37-23-5-3-2-4-21(23)29)24(25(30)34)31-26(33)20(19)12-16/h2-7,12,17-18,36H,10-11,13-15H2,1H3,(H2,30,34)/t17?,18?,28-/m0/s1

Standard InChI Key:  JLDZGENKRHQJFC-FIKOSDKTSA-N

Molfile:  

     RDKit          2D

 37 42  0  0  1  0  0  0  0  0999 V2000
    3.5635  -10.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6161   -9.5928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4425   -8.6587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9681   -7.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4272   -7.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6141   -7.5458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8789   -5.9722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3306   -4.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7822   -3.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7175   -2.0053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1695   -0.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.1195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0899   -0.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3421   -0.0893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6834   -0.7627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9377    0.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8483    1.5587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1003    2.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4417    1.7137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.5312    0.2164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2792   -0.6098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3509   -1.8076    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.0226   -2.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5767   -2.8095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -2.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1920   -3.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0115   -4.5334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3099   -2.9106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8672   -8.7652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9983   -9.1659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  6
  5  7  1  0
  7  8  3  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 13  1  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 26 27  1  0
 18 28  2  0
 28 29  1  0
 29 30  2  0
 30 17  1  0
 30 31  1  0
 31 12  1  0
 31 32  2  0
 32  9  1  0
 28 33  1  0
 33 34  2  0
 33 35  1  0
  5 36  1  0
 36  2  1  0
 36 37  2  0
M  END

Associated Targets(Human)

MAP3K14 Tchem Mitogen-activated protein kinase kinase kinase 14 (1412 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 516.99Molecular Weight (Monoisotopic): 516.1564AlogP: 3.26#Rotatable Bonds: 4
Polar Surface Area: 110.68Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.14CX Basic pKa: 2.19CX LogP: 2.79CX LogD: 2.79
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.52Np Likeness Score: -0.52

References

1.  (2015)  Tricyclic compounds and methods of use therefor, 

Source

Source(1):