The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9034866, 439 ID: ALA3696720
PubChem CID: 89754851
Max Phase: Preclinical
Molecular Formula: C20H18FN3O5S
Molecular Weight: 431.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CC[C@@](O)(C#Cc2cc3c(cc2F)OC[C@](C)(O)c2sc(C(N)=O)nc2-3)C1=O
Standard InChI: InChI=1S/C20H18FN3O5S/c1-19(27)9-29-13-8-12(21)10(3-4-20(28)5-6-24(2)18(20)26)7-11(13)14-15(19)30-17(23-14)16(22)25/h7-8,27-28H,5-6,9H2,1-2H3,(H2,22,25)/t19-,20-/m0/s1
Standard InChI Key: IEYNPJLLDVCWGR-PMACEKPBSA-N
Molfile:
RDKit 2D
30 33 0 0 1 0 0 0 0 0999 V2000
11.8700 -0.0163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6785 -0.1584 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6593 0.9422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2976 0.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5218 -1.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7866 -2.3038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0877 -0.6910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6535 -0.2486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2194 0.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1198 -0.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0042 -1.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4746 0.5191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 -2.9844 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.8661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 -2.9844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -5.3643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0432 -5.9628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0350 -5.9661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4522 2.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8856 1.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7653 2.4724 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.9467 -1.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4309 -2.5658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 1
5 7 1 0
7 8 3 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 6
15 17 1 0
15 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 11 1 0
22 18 2 0
20 23 1 0
23 24 2 0
23 25 1 0
12 26 1 0
26 27 2 0
27 9 1 0
27 28 1 0
5 29 1 0
29 2 1 0
29 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.45Molecular Weight (Monoisotopic): 431.0951AlogP: 0.59#Rotatable Bonds: 1Polar Surface Area: 125.98Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.02CX Basic pKa: ┄CX LogP: 0.41CX LogD: 0.41Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.57Np Likeness Score: -0.19
References 1. (2015) Tricyclic compounds and methods of use therefor,