The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9034866, 458 ID: ALA3696729
PubChem CID: 89755413
Max Phase: Preclinical
Molecular Formula: C20H16F3N3O5S
Molecular Weight: 467.43
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CC[C@@](O)(C#Cc2ccc3c(c2)-c2nc(C(N)=O)sc2[C@@](O)(C(F)(F)F)CO3)C1=O
Standard InChI: InChI=1S/C20H16F3N3O5S/c1-26-7-6-18(29,17(26)28)5-4-10-2-3-12-11(8-10)13-14(32-16(25-13)15(24)27)19(30,9-31-12)20(21,22)23/h2-3,8,29-30H,6-7,9H2,1H3,(H2,24,27)/t18-,19+/m0/s1
Standard InChI Key: NBHMPSMAEPUDTP-RBUKOAKNSA-N
Molfile:
RDKit 2D
32 35 0 0 1 0 0 0 0 0999 V2000
3.5635 -10.7916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6161 -9.5928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4425 -8.6587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9681 -7.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4272 -7.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6141 -7.5458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8789 -5.9722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3306 -4.5751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7822 -3.1780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7175 -2.0053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1695 -0.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1358 2.2582 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0899 -0.9120 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.0226 -2.4105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5767 -2.8095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -2.9545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1920 -3.3470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0115 -4.5334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3099 -2.9106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7072 0.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8866 -0.6903 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.8244 0.0581 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6453 1.2445 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8672 -8.7652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9983 -9.1659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 6
5 7 1 0
7 8 3 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 6
15 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 17 2 0
21 22 1 0
22 12 1 0
22 23 2 0
23 9 1 0
19 24 1 0
24 25 2 0
24 26 1 0
15 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
5 31 1 0
31 2 1 0
31 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.43Molecular Weight (Monoisotopic): 467.0763AlogP: 1.00#Rotatable Bonds: 1Polar Surface Area: 125.98Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.25CX Basic pKa: ┄CX LogP: 0.87CX LogD: 0.86Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -0.33
References 1. (2015) Tricyclic compounds and methods of use therefor,