US9034866, 460

ID: ALA3696731

PubChem CID: 86693531

Max Phase: Preclinical

Molecular Formula: C21H20N4O4

Molecular Weight: 392.42

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CC[C@@](O)(C#Cc2ccc3c(c2)-n2nc(C(N)=O)cc2C2(CC2)CO3)C1=O

Standard InChI:  InChI=1S/C21H20N4O4/c1-24-9-8-21(28,19(24)27)5-4-13-2-3-16-15(10-13)25-17(11-14(23-25)18(22)26)20(6-7-20)12-29-16/h2-3,10-11,28H,6-9,12H2,1H3,(H2,22,26)/t21-/m0/s1

Standard InChI Key:  XTLQTVSITXHZBU-NRFANRHFSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  1  0  0  0  0  0999 V2000
    3.5635  -10.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6161   -9.5928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4425   -8.6587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9681   -7.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4272   -7.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6141   -7.5458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8789   -5.9722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3306   -4.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7822   -3.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7175   -2.0053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1695   -0.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5424    1.9930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1566    2.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0899   -0.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0226   -2.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5767   -2.8095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -2.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1920   -3.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0115   -4.5334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3099   -2.9106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8672   -8.7652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9983   -9.1659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  6
  5  7  1  0
  7  8  3  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 15  1  0
 15 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 18  1  0
 22 23  1  0
 23 12  1  0
 23 24  2  0
 24  9  1  0
 20 25  1  0
 25 26  2  0
 25 27  1  0
  5 28  1  0
 28  2  1  0
 28 29  2  0
M  END

Associated Targets(Human)

MAP3K14 Tchem Mitogen-activated protein kinase kinase kinase 14 (1412 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.42Molecular Weight (Monoisotopic): 392.1485AlogP: 0.34#Rotatable Bonds: 1
Polar Surface Area: 110.68Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.14CX Basic pKa: CX LogP: 0.38CX LogD: 0.38
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.68Np Likeness Score: -0.30

References

1.  (2015)  Tricyclic compounds and methods of use therefor, 

Source

Source(1):