US9062026, Table III, Compound 88

ID: ALA3696939

PubChem CID: 73053323

Max Phase: Preclinical

Molecular Formula: C28H22N6O2

Molecular Weight: 474.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc2c(NCc3ccccc3)nc(-n3c(/C=C(/C#N)C(N)=O)cc4ccccc43)nc12

Standard InChI:  InChI=1S/C28H22N6O2/c1-36-24-13-7-11-22-25(24)32-28(33-27(22)31-17-18-8-3-2-4-9-18)34-21(15-20(16-29)26(30)35)14-19-10-5-6-12-23(19)34/h2-15H,17H2,1H3,(H2,30,35)(H,31,32,33)/b20-15-

Standard InChI Key:  YFQAZGJOYGKWKS-HKWRFOASSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    3.6387   -0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8994   -0.7523    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1981   -1.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4994   -0.7568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7984   -1.5068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0975   -0.7568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0976    0.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7985    1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4995    0.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -5.2508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0843   -6.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3373   -5.6360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4603   -6.6316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8844   -6.1578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0230   -5.7789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1621   -8.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0609   -8.8976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0243   -8.4837    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5458   -7.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0450   -7.5380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0471   -8.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5147   -8.3444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9803   -6.9185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9782   -5.8023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5105   -6.1121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  8 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20  3  1  0
 20  7  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  3  0
 24 27  1  0
 27 28  2  0
 27 29  1  0
 22 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 21  1  0
 36 31  1  0
M  END

Associated Targets(Human)

VCP Tchem Transitional endoplasmic reticulum ATPase (895 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.52Molecular Weight (Monoisotopic): 474.1804AlogP: 4.59#Rotatable Bonds: 7
Polar Surface Area: 118.85Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.95CX LogP: 4.81CX LogD: 4.81
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.26Np Likeness Score: -0.92

References

1.  (2015)  Fused pyrimidines and substituted quinazolines as inhibitors of p97, 

Source

Source(1):