US9062026, Table III, Compound 89

ID: ALA3696940

PubChem CID: 73053031

Max Phase: Preclinical

Molecular Formula: C27H24N4O3S

Molecular Weight: 484.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc2c(NCc3ccccc3)nc(-n3c(/C=C/S(C)(=O)=O)cc4ccccc43)nc12

Standard InChI:  InChI=1S/C27H24N4O3S/c1-34-24-14-8-12-22-25(24)29-27(30-26(22)28-18-19-9-4-3-5-10-19)31-21(15-16-35(2,32)33)17-20-11-6-7-13-23(20)31/h3-17H,18H2,1-2H3,(H,28,29,30)/b16-15+

Standard InChI Key:  PVXIJZLKROZTIT-FOCLMDBBSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    3.6387   -0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8994   -0.7523    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1981   -1.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4994   -0.7568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7984   -1.5068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0975   -0.7568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0976    0.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7985    1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4995    0.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -5.2508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0843   -6.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3373   -5.6360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4603   -6.6316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8844   -6.1578    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.7823   -6.9538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1252   -4.9822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0228   -5.7784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5458   -7.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0450   -7.5380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0471   -8.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5147   -8.3444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9803   -6.9185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9782   -5.8023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5105   -6.1121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  8 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20  3  1  0
 20  7  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 25 27  2  0
 25 28  1  0
 22 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 21  1  0
 35 30  1  0
M  END

Associated Targets(Human)

VCP Tchem Transitional endoplasmic reticulum ATPase (895 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.58Molecular Weight (Monoisotopic): 484.1569AlogP: 5.21#Rotatable Bonds: 7
Polar Surface Area: 86.11Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.96CX LogP: 4.70CX LogD: 4.70
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -0.70

References

1.  (2015)  Fused pyrimidines and substituted quinazolines as inhibitors of p97, 

Source

Source(1):