The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[4-(8-Dimethylamino-5,6,7,8-tetrahydro-thieno[3,2-b]azepine-4-carbonyl)-phenyl]-2-methyl-benzamide ID: ALA369712
PubChem CID: 44386548
Max Phase: Preclinical
Molecular Formula: C25H27N3O2S
Molecular Weight: 433.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1C(=O)Nc1ccc(C(=O)N2CCCC(N(C)C)c3sccc32)cc1
Standard InChI: InChI=1S/C25H27N3O2S/c1-17-7-4-5-8-20(17)24(29)26-19-12-10-18(11-13-19)25(30)28-15-6-9-21(27(2)3)23-22(28)14-16-31-23/h4-5,7-8,10-14,16,21H,6,9,15H2,1-3H3,(H,26,29)
Standard InChI Key: OEFAJMDMCVQKRS-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
2.4042 0.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4042 1.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0500 0.1458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8667 -0.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1042 -3.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0500 1.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6167 1.7458 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.6167 0.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2875 -2.8917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7125 -4.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1375 1.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4750 -1.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8625 2.8000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0792 -0.9000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3167 -3.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5292 -5.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2542 -0.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2875 -2.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6792 -2.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8500 0.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8917 -2.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8625 -1.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8500 1.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2042 1.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 -4.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4667 3.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0667 3.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7417 -5.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1375 -5.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1042 -4.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9250 -5.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 3 1 0
5 9 1 0
6 2 1 0
7 2 1 0
8 1 1 0
9 19 1 0
10 5 1 0
11 8 2 0
12 4 1 0
13 6 1 0
14 4 2 0
15 5 2 0
16 10 2 0
17 12 1 0
18 12 2 0
19 21 2 0
20 3 1 0
21 18 1 0
22 17 2 0
23 6 1 0
24 20 1 0
25 10 1 0
26 13 1 0
27 13 1 0
28 16 1 0
29 16 1 0
30 25 2 0
31 30 1 0
7 11 1 0
24 23 1 0
22 19 1 0
29 31 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.58Molecular Weight (Monoisotopic): 433.1824AlogP: 5.35#Rotatable Bonds: 4Polar Surface Area: 52.65Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.30CX LogP: 4.85CX LogD: 3.90Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -1.67
References 1. Itzhak Y, Kalir A, Weissman BA, Cohen S.. (1981) New analgesic drugs derived from phencyclidine., 24 (5): [PMID:7241506 ] [10.1021/jm00137a004 ]