The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8853193, 13-3 ID: ALA3698933
PubChem CID: 58413389
Max Phase: Preclinical
Molecular Formula: C23H27FN4O4S
Molecular Weight: 474.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1sc2ncnc(Nc3ccc(F)cc3OC(C)CCNC(=O)C(C)C)c2c1C
Standard InChI: InChI=1S/C23H27FN4O4S/c1-12(2)21(29)25-9-8-13(3)32-17-10-15(24)6-7-16(17)28-20-18-14(4)19(23(30)31-5)33-22(18)27-11-26-20/h6-7,10-13H,8-9H2,1-5H3,(H,25,29)(H,26,27,28)
Standard InChI Key: CWILDQNWIBHZHM-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
4.6580 -5.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0559 -4.4171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5551 -4.4192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9569 -5.4595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 -1.4978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8939 0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1904 1.5090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4920 0.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5291 1.3671 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.4971 -0.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2007 -1.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2090 -2.9918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.5125 -3.7358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5485 -3.1303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5208 -5.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8242 -5.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8325 -7.4814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.1359 -8.2254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1720 -7.6200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.1443 -9.7262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1864 -10.3211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1082 -10.3316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4916 -3.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
16 18 1 0
18 19 2 0
19 13 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
26 28 1 0
28 29 1 0
28 30 1 0
11 31 2 0
31 7 1 0
31 32 1 0
32 5 2 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.56Molecular Weight (Monoisotopic): 474.1737AlogP: 4.60#Rotatable Bonds: 9Polar Surface Area: 102.44Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.96CX LogP: 4.70CX LogD: 4.70Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.44Np Likeness Score: -1.73
References 1. (2014) Thienopyrimidines containing a substituted alkyl group for pharmaceutical compositions,