The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8853193, 13-4 ID: ALA3698934
PubChem CID: 58413344
Max Phase: Preclinical
Molecular Formula: C24H30FN5O4S
Molecular Weight: 503.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCNC(=O)NCCC(C)Oc1cc(F)ccc1Nc1ncnc2sc(C(=O)OC)c(C)c12
Standard InChI: InChI=1S/C24H30FN5O4S/c1-5-6-10-26-24(32)27-11-9-14(2)34-18-12-16(25)7-8-17(18)30-21-19-15(3)20(23(31)33-4)35-22(19)29-13-28-21/h7-8,12-14H,5-6,9-11H2,1-4H3,(H2,26,27,32)(H,28,29,30)
Standard InChI Key: RHQNHAFJMSZABV-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
11.7662 -13.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7595 -12.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4561 -11.9710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4477 -10.4702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1443 -9.7262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1360 -8.2254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1721 -7.6199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8326 -7.4814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8242 -5.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5208 -5.2365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5125 -3.7357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5485 -3.1303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2090 -2.9917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2007 -1.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4972 -0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4920 0.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5291 1.3672 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1903 1.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8939 0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4133 -1.7530 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5550 -4.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9569 -5.4595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0559 -4.4171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6580 -5.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4916 -3.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
11 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
16 18 2 0
18 19 1 0
19 20 2 0
20 14 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
28 33 2 0
33 34 1 0
33 35 1 0
35 22 1 0
35 26 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.60Molecular Weight (Monoisotopic): 503.2003AlogP: 4.93#Rotatable Bonds: 11Polar Surface Area: 114.47Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.96CX LogP: 4.67CX LogD: 4.67Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.25Np Likeness Score: -1.77
References 1. (2014) Thienopyrimidines containing a substituted alkyl group for pharmaceutical compositions,