US8853193, 15-2

ID: ALA3698936

PubChem CID: 58413302

Max Phase: Preclinical

Molecular Formula: C18H21N5O3S

Molecular Weight: 387.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1sc2ncnc(Nc3cccnc3OC(C)CCN)c2c1C

Standard InChI:  InChI=1S/C18H21N5O3S/c1-10(6-7-19)26-16-12(5-4-8-20-16)23-15-13-11(2)14(18(24)25-3)27-17(13)22-9-21-15/h4-5,8-10H,6-7,19H2,1-3H3,(H,21,22,23)

Standard InChI Key:  VTBUOEIKBOTRGK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    4.6580   -5.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0559   -4.4171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5551   -4.4192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9569   -5.4595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003   -1.4978    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8939    0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1904    1.5090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4920    0.7635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4971   -0.7365    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2007   -1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2090   -2.9918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5125   -3.7358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5485   -3.1303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5208   -5.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8242   -5.9806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8309   -7.1806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4916   -3.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 11 25  2  0
 25  7  1  0
 25 26  1  0
 26  5  2  0
 26 27  1  0
M  END

Associated Targets(Human)

MKNK2 Tchem MAP kinase signal-integrating kinase 2 (3518 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 387.47Molecular Weight (Monoisotopic): 387.1365AlogP: 3.04#Rotatable Bonds: 7
Polar Surface Area: 112.25Molecular Species: BASEHBA: 9HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.01CX Basic pKa: 9.93CX LogP: 2.88CX LogD: 0.46
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.59Np Likeness Score: -1.52

References

1.  (2014)  Thienopyrimidines containing a substituted alkyl group for pharmaceutical compositions, 

Source

Source(1):