The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8853193, 16-3 ID: ALA3698938
PubChem CID: 58413314
Max Phase: Preclinical
Molecular Formula: C22H31N7O2S
Molecular Weight: 457.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(C(=O)NCCCN(C)C)sc2ncnc(Nc3cccnc3OC(C)CCN)c12
Standard InChI: InChI=1S/C22H31N7O2S/c1-14(8-9-23)31-21-16(7-5-10-25-21)28-19-17-15(2)18(32-22(17)27-13-26-19)20(30)24-11-6-12-29(3)4/h5,7,10,13-14H,6,8-9,11-12,23H2,1-4H3,(H,24,30)(H,26,27,28)
Standard InChI Key: PERNZYRQNVVDHP-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
7.5485 -3.1303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5125 -3.7357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5208 -5.2365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8242 -5.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8309 -7.1805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2090 -2.9917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2007 -1.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4972 -0.7364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4920 0.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1903 1.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8939 0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4133 -1.7530 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5550 -4.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9569 -5.4595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0559 -4.4171 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.8090 -5.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3098 -5.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0629 -7.0113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.5637 -7.0092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.1659 -8.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1619 -5.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4916 -3.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
2 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
20 30 2 0
30 31 1 0
30 32 1 0
32 14 1 0
32 18 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.60Molecular Weight (Monoisotopic): 457.2260AlogP: 2.94#Rotatable Bonds: 11Polar Surface Area: 118.29Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.05CX Basic pKa: 10.02CX LogP: 2.03CX LogD: -2.28Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.38Np Likeness Score: -1.67
References 1. (2014) Thienopyrimidines containing a substituted alkyl group for pharmaceutical compositions,