US8853193, 16-4

ID: ALA3698939

PubChem CID: 58413291

Max Phase: Preclinical

Molecular Formula: C17H20N6O2S

Molecular Weight: 372.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(C(N)=O)sc2ncnc(Nc3cccnc3OC(C)CCN)c12

Standard InChI:  InChI=1S/C17H20N6O2S/c1-9(5-6-18)25-16-11(4-3-7-20-16)23-15-12-10(2)13(14(19)24)26-17(12)22-8-21-15/h3-4,7-9H,5-6,18H2,1-2H3,(H2,19,24)(H,21,22,23)

Standard InChI Key:  HTVNCUQKQNWSAE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    7.5485   -3.1303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5125   -3.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5208   -5.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8242   -5.9806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8309   -7.1805    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2090   -2.9917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2007   -1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4972   -0.7364    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4920    0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1903    1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8939    0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133   -1.7530    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5550   -4.4193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7550   -4.4175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9569   -5.4595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4916   -3.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  2  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 20 24  2  0
 24 25  1  0
 24 26  1  0
 26 14  1  0
 26 18  2  0
M  END

Associated Targets(Human)

MKNK2 Tchem MAP kinase signal-integrating kinase 2 (3518 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 372.45Molecular Weight (Monoisotopic): 372.1368AlogP: 2.35#Rotatable Bonds: 7
Polar Surface Area: 129.04Molecular Species: BASEHBA: 8HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 13.03CX Basic pKa: 9.93CX LogP: 1.72CX LogD: -0.69
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.58Np Likeness Score: -1.59

References

1.  (2014)  Thienopyrimidines containing a substituted alkyl group for pharmaceutical compositions, 

Source

Source(1):