The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8853193, 19-1 ID: ALA3698941
PubChem CID: 58413248
Max Phase: Preclinical
Molecular Formula: C20H22FN5O4S
Molecular Weight: 447.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1sc2ncnc(Nc3ccc(F)cc3OC(CN)CNC(C)=O)c2c1C
Standard InChI: InChI=1S/C20H22FN5O4S/c1-10-16-18(24-9-25-19(16)31-17(10)20(28)29-3)26-14-5-4-12(21)6-15(14)30-13(7-22)8-23-11(2)27/h4-6,9,13H,7-8,22H2,1-3H3,(H,23,27)(H,24,25,26)
Standard InChI Key: RBYNIYZLGVBSMK-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
4.6580 -5.4551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0559 -4.4171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5551 -4.4192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9569 -5.4595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 -1.4978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8939 0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1904 1.5090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4920 0.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5291 1.3671 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.4971 -0.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2007 -1.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2090 -2.9918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.5125 -3.7358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8098 -2.9812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8513 -3.5773 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.5208 -5.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8242 -5.9806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.8325 -7.4814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8747 -8.0763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7964 -8.0868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4916 -3.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
16 18 1 0
18 19 2 0
19 13 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
21 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
26 28 1 0
11 29 2 0
29 7 1 0
29 30 1 0
30 5 2 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.49Molecular Weight (Monoisotopic): 447.1377AlogP: 2.51#Rotatable Bonds: 8Polar Surface Area: 128.46Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.88CX LogP: 2.25CX LogD: 0.77Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.45Np Likeness Score: -1.51
References 1. (2014) Thienopyrimidines containing a substituted alkyl group for pharmaceutical compositions,