US8993612, 18

ID: ALA3699939

PubChem CID: 52914063

Max Phase: Preclinical

Molecular Formula: C22H16F3N5O

Molecular Weight: 423.40

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(-n2nc(C(F)(F)F)cc2C2CC2)cc1)c1ccc2nccnc2c1

Standard InChI:  InChI=1S/C22H16F3N5O/c23-22(24,25)20-12-19(13-1-2-13)30(29-20)16-6-4-15(5-7-16)28-21(31)14-3-8-17-18(11-14)27-10-9-26-17/h3-13H,1-2H2,(H,28,31)

Standard InChI Key:  JHUUUHBVXPRICU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   12.3443   -7.3078    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.6368   -6.3385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1228   -5.2414    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.8300   -6.2107    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.1470   -6.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3990   -7.7977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9313   -7.4881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8117   -8.4874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4446   -8.8620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5445   -9.8819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7911   -6.0075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1416   -5.3843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4915   -5.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1924   -6.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8934   -5.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1925   -3.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4915   -3.7571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  2  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10  8  1  0
  7 11  1  0
 11 12  1  0
 12  5  2  0
 11 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 23  1  0
 28 29  2  0
 29 20  1  0
 16 30  1  0
 30 31  2  0
 31 13  1  0
M  END

Associated Targets(Human)

ORAI1 Tchem Calcium release-activated calcium channel protein 1 (150 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.40Molecular Weight (Monoisotopic): 423.1307AlogP: 4.96#Rotatable Bonds: 4
Polar Surface Area: 72.70Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.09CX LogP: 4.36CX LogD: 4.36
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.50Np Likeness Score: -1.68

References

1.  (2015)  Modulators of calcium release-activated calcium channel and methods for treatment of non-small cell lung cancer, 

Source

Source(1):