US9090596, 8

ID: ALA3701188

PubChem CID: 71525884

Max Phase: Preclinical

Molecular Formula: C27H29N3O8

Molecular Weight: 523.54

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H]1CCCN1C(=O)c1cccc(Nc2c(N[C@@H](c3ccc(C)o3)C3(C)COC3)c(=O)c2=O)c1O

Standard InChI:  InChI=1S/C27H29N3O8/c1-14-9-10-18(38-14)24(27(2)12-37-13-27)29-20-19(22(32)23(20)33)28-16-7-4-6-15(21(16)31)25(34)30-11-5-8-17(30)26(35)36-3/h4,6-7,9-10,17,24,28-29,31H,5,8,11-13H2,1-3H3/t17-,24+/m1/s1

Standard InChI Key:  SIUQYAWDXLUCLD-OSPHWJPCSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  1  0  0  0  0  0999 V2000
    7.2340   -4.4700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9870   -3.2957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5609   -2.8279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6672   -3.6286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2526   -1.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2524   -0.2436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4979    1.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0317    0.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6024   -2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003   -1.4978    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3046   -1.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0395   -2.4562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5402   -2.4718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3036   -1.1797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.7857   -1.0547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1103    0.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.2107    0.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8178    1.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6944    0.1770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2780   -3.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4779   -3.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8728   -4.0722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2467   -5.5249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6994   -5.1510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6877    0.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7249    0.8992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2375    0.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6210    1.7083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  5  3  1  6
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 21 20  1  6
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 26 27  1  0
 27 22  2  0
 21 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 28  1  0
 19 33  1  0
 33 34  2  0
 33 35  1  0
 35 18  1  0
 35 36  2  0
 16 37  2  0
 37 12  1  0
 37 38  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3701188

   methyl (2R)-1-[2-hydroxy-3-[[2-[[(R)-(5-methylfuran-2-yl)-(3-methyloxetan-3-yl)methyl]amino]-3,4-dioxocyclobuten-1-yl]amino]benzoyl]pyrrolidine-2-carboxylate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 523.54

Molecular Weight (Monoisotopic): 523.1955

AlogP: 2.60

#Rotatable Bonds: 8

Polar Surface Area: 147.41

Molecular Species: NEUTRAL

HBA: 10

HBD: 3

#RO5 Violations: 1

HBA (Lipinski): 11

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 8.04

CX Basic pKa: ┄

CX LogP: 2.15

CX LogD: 2.06

Aromatic Rings: 3

Heavy Atoms: 38

QED Weighted: 0.23

Np Likeness Score: -0.50

References

1.  (2015)  Disubstituted 3,4-diamino-3-cyclobutene-1,2-dione compounds for use in the treatment of chemokine-mediated pathologies, 

2. Tawaraishi, Taisuke T and 7 more authors.  2018-10-01  Identification of a novel series of potent and selective CCR6 inhibitors as biological probes.  [PMID:30098865]

Source

Source(1):

• BindingDB Database