US8772283, 54

ID: ALA3701768

PubChem CID: 86766566

Max Phase: Preclinical

Molecular Formula: C30H30N4O3

Molecular Weight: 494.60

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)C(=O)c1ccc2c(c1)-c1nc(-c3ccc(C4(N)CC(C)(O)C4)cc3)c(-c3ccccc3)n1CO2

Standard InChI:  InChI=1S/C30H30N4O3/c1-29(36)16-30(31,17-29)22-12-9-19(10-13-22)25-26(20-7-5-4-6-8-20)34-18-37-24-14-11-21(28(35)33(2)3)15-23(24)27(34)32-25/h4-15,36H,16-18,31H2,1-3H3

Standard InChI Key:  FIZJSLYYMQWTHP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
    3.6331   -3.6060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5548   -3.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9095   -2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4013   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1517   -4.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5029   -5.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3485   -7.0088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8442   -6.8960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4944   -5.5442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6488   -4.3053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6905   -8.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8869   -8.0427    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3158   -8.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8135   -9.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6167  -10.0516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4943  -10.9523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2285   -9.4664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0114   -1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4793   -1.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5600   -2.4740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9995   -2.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.3542   -0.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2694    0.4409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8298    0.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 25 28  1  0
 28 22  1  0
 15 29  2  0
 29 12  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 13 36  1  0
 36  9  1  0
 36 37  2  0
 37  6  1  0
M  END

Associated Targets(Human)

AKT2 Tchem Serine/threonine-protein kinase AKT2 (4301 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AKT1 Tchem Serine/threonine-protein kinase AKT (9192 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 494.60Molecular Weight (Monoisotopic): 494.2318AlogP: 4.63#Rotatable Bonds: 4
Polar Surface Area: 93.61Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.06CX LogP: 3.49CX LogD: 1.84
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.43Np Likeness Score: -0.57

References

1.  (2014)  Imidazo-oxazine compound or salt thereof, 

Source

Source(1):