The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8772283, 62 ID: ALA3701776
PubChem CID: 86766572
Max Phase: Preclinical
Molecular Formula: C28H26N4O3
Molecular Weight: 466.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1(O)CC(N)(c2ccc(-c3nc4n(c3-c3ccccc3)COc3cc(C(N)=O)ccc3-4)cc2)C1
Standard InChI: InChI=1S/C28H26N4O3/c1-27(34)14-28(30,15-27)20-10-7-17(8-11-20)23-24(18-5-3-2-4-6-18)32-16-35-22-13-19(25(29)33)9-12-21(22)26(32)31-23/h2-13,34H,14-16,30H2,1H3,(H2,29,33)
Standard InChI Key: OIZPCNODPMXFQK-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
7.1958 -7.6404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5216 -8.6331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0370 -9.7168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5450 -7.4946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4995 -8.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8209 -9.4680 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3830 -9.6097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8490 -7.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6946 -5.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0445 -4.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5536 -4.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7031 -5.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3532 -7.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6928 -4.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1743 -3.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0913 -5.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5218 -6.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0353 -6.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1183 -5.4691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2959 5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2558 5.8494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3341 5.8527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 1 0
5 7 1 0
7 2 1 0
5 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 16 1 0
25 26 1 0
26 14 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
20 33 1 0
33 34 2 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.54Molecular Weight (Monoisotopic): 466.2005AlogP: 4.03#Rotatable Bonds: 4Polar Surface Area: 116.39Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.84CX Basic pKa: 9.06CX LogP: 3.04CX LogD: 1.39Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.42Np Likeness Score: -0.27
References 1. (2014) Imidazo-oxazine compound or salt thereof,