US8772283, 62

ID: ALA3701776

PubChem CID: 86766572

Max Phase: Preclinical

Molecular Formula: C28H26N4O3

Molecular Weight: 466.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(O)CC(N)(c2ccc(-c3nc4n(c3-c3ccccc3)COc3cc(C(N)=O)ccc3-4)cc2)C1

Standard InChI:  InChI=1S/C28H26N4O3/c1-27(34)14-28(30,15-27)20-10-7-17(8-11-20)23-24(18-5-3-2-4-6-18)32-16-35-22-13-19(25(29)33)9-12-21(22)26(32)31-23/h2-13,34H,14-16,30H2,1H3,(H2,29,33)

Standard InChI Key:  OIZPCNODPMXFQK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
    7.1958   -7.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5216   -8.6331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0370   -9.7168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5450   -7.4946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4995   -8.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8209   -9.4680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3830   -9.6097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8490   -7.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6946   -5.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0445   -4.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5536   -4.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7031   -5.6606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3532   -7.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5981    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6928   -4.0817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1743   -3.8808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0913   -5.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5218   -6.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0353   -6.6562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1183   -5.4691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2959    5.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2558    5.8494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3341    5.8527    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  2  1  0
  5  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 11 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 16  1  0
 25 26  1  0
 26 14  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 20 33  1  0
 33 34  2  0
 33 35  1  0
M  END

Associated Targets(Human)

AKT2 Tchem Serine/threonine-protein kinase AKT2 (4301 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AKT1 Tchem Serine/threonine-protein kinase AKT (9192 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 466.54Molecular Weight (Monoisotopic): 466.2005AlogP: 4.03#Rotatable Bonds: 4
Polar Surface Area: 116.39Molecular Species: BASEHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 13.84CX Basic pKa: 9.06CX LogP: 3.04CX LogD: 1.39
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.42Np Likeness Score: -0.27

References

1.  (2014)  Imidazo-oxazine compound or salt thereof, 

Source

Source(1):