The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8772283, 64 ID: ALA3701778
PubChem CID: 86766574
Max Phase: Preclinical
Molecular Formula: C28H24N2O5
Molecular Weight: 468.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1(O)CC(O)(c2ccc(-c3nc4n(c3-c3ccccc3)COc3cc(C(=O)O)ccc3-4)cc2)C1
Standard InChI: InChI=1S/C28H24N2O5/c1-27(33)14-28(34,15-27)20-10-7-17(8-11-20)23-24(18-5-3-2-4-6-18)30-16-35-22-13-19(26(31)32)9-12-21(22)25(30)29-23/h2-13,33-34H,14-16H2,1H3,(H,31,32)
Standard InChI Key: OWOHMQRWTOYGDX-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
7.1958 -7.6404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5216 -8.6331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0370 -9.7168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5450 -7.4946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4995 -8.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8209 -9.4680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3830 -9.6097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8490 -7.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6946 -5.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0445 -4.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5536 -4.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7031 -5.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3532 -7.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6928 -4.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1743 -3.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0913 -5.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5218 -6.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0353 -6.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1183 -5.4691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2959 5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2558 5.8494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3341 5.8527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 1 0
5 7 1 0
7 2 1 0
5 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 16 1 0
25 26 1 0
26 14 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
20 33 1 0
33 34 2 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.51Molecular Weight (Monoisotopic): 468.1685AlogP: 4.66#Rotatable Bonds: 4Polar Surface Area: 104.81Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.51CX Basic pKa: 4.43CX LogP: 3.04CX LogD: 0.66Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.40Np Likeness Score: -0.10
References 1. (2014) Imidazo-oxazine compound or salt thereof,