The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8853203, 99i ID: ALA3702465
PubChem CID: 73336217
Max Phase: Preclinical
Molecular Formula: C21H21FN4O2
Molecular Weight: 380.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COCc1cn(C2=NCC(=O)N3CCc4c(C5CC5)ccc(F)c4C3=C2)cn1
Standard InChI: InChI=1S/C21H21FN4O2/c1-28-11-14-10-25(12-24-14)19-8-18-21-16(6-7-26(18)20(27)9-23-19)15(13-2-3-13)4-5-17(21)22/h4-5,8,10,12-13H,2-3,6-7,9,11H2,1H3
Standard InChI Key: VTJXVUYJMWDVSF-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 32 0 0 0 0 0 0 0 0999 V2000
9.2019 -0.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1240 -0.5452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8782 0.2916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5324 -0.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2056 0.3328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1484 -0.7186 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7923 -2.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2769 -1.8450 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2897 1.8259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1695 -0.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7175 -2.0053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7822 -3.1781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3302 -4.5744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3950 -5.7471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9117 -5.5235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3637 -4.1272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8229 -3.9484 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -2.9545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8142 -4.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1210 -4.2385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8951 -5.7214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 2 0
8 4 1 0
6 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
21 23 2 0
23 17 1 0
23 24 1 0
24 14 1 0
24 25 2 0
25 9 1 0
18 26 1 0
26 27 1 0
27 28 1 0
28 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 380.42Molecular Weight (Monoisotopic): 380.1649AlogP: 2.73#Rotatable Bonds: 3Polar Surface Area: 59.72Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.89CX LogP: 1.20CX LogD: 1.20Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.82Np Likeness Score: -0.59
References 1. (2014) Diazepinone derivatives,