US8889672, 194-074-005

ID: ALA3702547

PubChem CID: 71009747

Max Phase: Preclinical

Molecular Formula: C17H20N2O4S

Molecular Weight: 348.42

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2csc(N)c2C(=O)N2CCOCC2)cc1OC

Standard InChI:  InChI=1S/C17H20N2O4S/c1-21-13-4-3-11(9-14(13)22-2)12-10-24-16(18)15(12)17(20)19-5-7-23-8-6-19/h3-4,9-10H,5-8,18H2,1-2H3

Standard InChI Key:  GMQDXCYJGRIXJX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
    3.6387   -0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0432   -3.5994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9492    0.8772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9546    1.9903    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2067    3.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6965    4.3860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7390    2.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6175    3.9744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8577    5.1501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1936    3.4998    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9307    4.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3528    4.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6506    2.5455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5263    1.5525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1043    2.0296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  8  9  1  0
  9 10  1  0
  6 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 16 11  1  0
 16 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 19  1  0
M  END

Associated Targets(Human)

PRKCZ Tchem Protein kinase C zeta (2414 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 348.42Molecular Weight (Monoisotopic): 348.1144AlogP: 2.49#Rotatable Bonds: 4
Polar Surface Area: 74.02Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.15CX LogD: 2.15
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.92Np Likeness Score: -1.20

References

1.  (2014)  Compounds, formulations, and methods of protein kinase C inhibition, 

Source

Source(1):