US8889672, APOGEE B

ID: ALA3702555

PubChem CID: 71009778

Max Phase: Preclinical

Molecular Formula: C17H16ClNO4S

Molecular Weight: 365.84

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1c(NC(C)=O)sc(C(C)=O)c1-c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C17H16ClNO4S/c1-4-23-17(22)14-13(11-5-7-12(18)8-6-11)15(9(2)20)24-16(14)19-10(3)21/h5-8H,4H2,1-3H3,(H,19,21)

Standard InChI Key:  FOVNOIYDJMJWRZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 25  0  0  0  0  0  0  0  0999 V2000
   -2.0766   -4.1006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9394   -4.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1873   -3.4922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6096   -3.9713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8461   -5.1477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7343   -2.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2010   -3.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8111   -4.6641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3037   -4.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7923   -5.9172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0088   -3.8502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9531   -1.9978    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.9511   -0.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2567    0.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3963    0.9614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3615    1.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
  7 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 13 17  2  0
 17  6  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 21 23  1  0
 23 24  2  0
 24 18  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

PRKCZ Tchem Protein kinase C zeta (2414 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 365.84Molecular Weight (Monoisotopic): 365.0489AlogP: 4.41#Rotatable Bonds: 5
Polar Surface Area: 72.47Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.46CX Basic pKa: CX LogP: 4.11CX LogD: 4.11
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.63Np Likeness Score: -1.24

References

1.  (2014)  Compounds, formulations, and methods of protein kinase C inhibition, 

Source

Source(1):