The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8975265, 8-1 ID: ALA3703160
PubChem CID: 89706019
Max Phase: Preclinical
Molecular Formula: C28H29N3O
Molecular Weight: 423.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)CCc1ccc2nc(-c3ccc(C4(N)CCC4)cc3)c(-c3ccccc3)n2c1
Standard InChI: InChI=1S/C28H29N3O/c1-2-24(32)15-9-20-10-16-25-30-26(27(31(25)19-20)22-7-4-3-5-8-22)21-11-13-23(14-12-21)28(29)17-6-18-28/h3-5,7-8,10-14,16,19H,2,6,9,15,17-18,29H2,1H3
Standard InChI Key: QPZLPAWHYDKCJE-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
4.9292 -5.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9336 -3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 1.2135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6065 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1072 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9493 1.2353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4450 1.1224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0952 -0.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2495 -1.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7538 -1.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.5917 -0.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1096 -1.4250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.2626 1.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.7369 1.3313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.0134 -0.1430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7248 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1884 -2.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6234 -3.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9781 -4.5176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 -5.5536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4537 -5.1320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0990 -3.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 1 0
19 21 1 0
21 22 1 0
22 23 1 0
23 19 1 0
12 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
24 31 1 0
31 10 1 0
31 32 1 0
32 7 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.56Molecular Weight (Monoisotopic): 423.2311AlogP: 5.92#Rotatable Bonds: 7Polar Surface Area: 60.39Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.53CX LogP: 5.43CX LogD: 3.35Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: -0.28
References 1. (2015) Substituted imidazo[1,2-a]pyrimidines and —pyridines,