US8975265, 8-1

ID: ALA3703160

PubChem CID: 89706019

Max Phase: Preclinical

Molecular Formula: C28H29N3O

Molecular Weight: 423.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(=O)CCc1ccc2nc(-c3ccc(C4(N)CCC4)cc3)c(-c3ccccc3)n2c1

Standard InChI:  InChI=1S/C28H29N3O/c1-2-24(32)15-9-20-10-16-25-30-26(27(31(25)19-20)22-7-4-3-5-8-22)21-11-13-23(14-12-21)28(29)17-6-18-28/h3-5,7-8,10-14,16,19H,2,6,9,15,17-18,29H2,1H3

Standard InChI Key:  QPZLPAWHYDKCJE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    4.9292   -5.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9336   -3.1588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248    1.2135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6065    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1072    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9493    1.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4450    1.1224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0952   -0.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2495   -1.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7538   -1.3554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.5917   -0.3425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1096   -1.4250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2626    1.0548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7369    1.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.0134   -0.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248   -1.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1884   -2.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6234   -3.0602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9781   -4.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8933   -5.5536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4537   -5.1320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0990   -3.6745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  1  0
 12 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 24 31  1  0
 31 10  1  0
 31 32  1  0
 32  7  2  0
M  END

Associated Targets(Human)

AKT2 Tchem Serine/threonine-protein kinase AKT2 (4301 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.56Molecular Weight (Monoisotopic): 423.2311AlogP: 5.92#Rotatable Bonds: 7
Polar Surface Area: 60.39Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.53CX LogP: 5.43CX LogD: 3.35
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: -0.28

References

1.  (2015)  Substituted imidazo[1,2-a]pyrimidines and ‚Äîpyridines, 

Source

Source(1):