The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9018255, 3b ID: ALA3703580
PubChem CID: 56945840
Max Phase: Preclinical
Molecular Formula: C21H26Cl2N2O6
Molecular Weight: 473.35
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(COC(=O)c1c(Cl)cccc1Cl)C(=O)NC(CC(C)C)C(=O)NCC(=O)OCC
Standard InChI: InChI=1S/C21H26Cl2N2O6/c1-5-30-17(26)10-24-20(28)16(9-12(2)3)25-19(27)13(4)11-31-21(29)18-14(22)7-6-8-15(18)23/h6-8,12,16H,4-5,9-11H2,1-3H3,(H,24,28)(H,25,27)
Standard InChI Key: ZQEFBSNKAVWNJR-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 31 0 0 0 0 0 0 0 0999 V2000
10.3720 -16.2265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3737 -15.0265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0755 -14.2734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0776 -12.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1179 -12.1744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7794 -12.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7815 -10.5187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4833 -9.7656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4431 -10.3638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4855 -8.2648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7850 -7.5140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7855 -6.0132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8245 -5.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7462 -5.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2297 -5.4127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8509 -5.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3383 1.3500 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 1 0
10 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 2 0
25 26 1 0
25 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 24 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.35Molecular Weight (Monoisotopic): 472.1168AlogP: 2.92#Rotatable Bonds: 11Polar Surface Area: 110.80Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.97CX Basic pKa: ┄CX LogP: 3.47CX LogD: 3.47Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.38Np Likeness Score: -0.57
References 1. (2015) Esters of (acyloxymethyl)acrylamide, a pharmaceutical composition containing them, and their use as inhibitors of the thioredoxin—thioredoxin reductase system,