The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9018255, 8a ID: ALA3703581
PubChem CID: 56961830
Max Phase: Preclinical
Molecular Formula: C20H15F6NO3
Molecular Weight: 431.33
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(COC(=O)c1c(C(F)(F)F)cccc1C(F)(F)F)C(=O)NCc1ccccc1
Standard InChI: InChI=1S/C20H15F6NO3/c1-12(17(28)27-10-13-6-3-2-4-7-13)11-30-18(29)16-14(19(21,22)23)8-5-9-15(16)20(24,25)26/h2-9H,1,10-11H2,(H,27,28)
Standard InChI Key: YVRPNJWMIOZDRD-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
3.6384 -0.9011 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5988 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5984 -2.7004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.6377 -2.1009 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0351 -3.6026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 -3.7494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6078 -5.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6460 -5.3970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6109 -7.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5727 -8.1014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9117 -8.2481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9148 -9.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2157 -10.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2209 -11.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5226 -12.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8190 -11.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8138 -10.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5122 -9.7431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5988 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6384 -0.9011 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5984 -2.7004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6377 -2.1009 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
9 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.33Molecular Weight (Monoisotopic): 431.0956AlogP: 4.75#Rotatable Bonds: 6Polar Surface Area: 55.40Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.24CX Basic pKa: ┄CX LogP: 5.04CX LogD: 5.04Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.41Np Likeness Score: -0.72
References 1. (2015) Esters of (acyloxymethyl)acrylamide, a pharmaceutical composition containing them, and their use as inhibitors of the thioredoxin—thioredoxin reductase system,