US9023865, 11

ID: ALA3703711

PubChem CID: 71555313

Max Phase: Preclinical

Molecular Formula: C21H19FN6O

Molecular Weight: 390.42

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(-c2n[nH]c3cc(NC(=O)N[C@@H](C)c4ccc(F)cc4)ncc23)ccn1

Standard InChI:  InChI=1S/C21H19FN6O/c1-12-9-15(7-8-23-12)20-17-11-24-19(10-18(17)27-28-20)26-21(29)25-13(2)14-3-5-16(22)6-4-14/h3-11,13H,1-2H3,(H,27,28)(H2,24,25,26,29)/t13-/m0/s1

Standard InChI Key:  NTCHHCRAGXQOCH-ZDUSSCGKSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  1  0  0  0  0  0999 V2000
    2.8509   -5.8560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5548   -3.6021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3115    2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032    3.1233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133    1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8813    1.4408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9619    2.4739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4015    2.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7561    0.5949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6713   -0.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9551   -1.6070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2318   -0.0195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1894   -6.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4911   -5.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7876   -6.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7824   -7.5198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8196   -8.1234    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.4809   -8.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1844   -7.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 19 13  1  0
 12 20  1  0
 20  9  2  0
 20 21  1  0
 21 22  2  0
 22  7  1  0
  2 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 26 28  1  0
 28 29  2  0
 29 23  1  0
M  END

Associated Targets(Human)

MAPK1 Tchem MAP kinase ERK2 (25055 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Mapk1 MAP kinase ERK2 (650 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 390.42Molecular Weight (Monoisotopic): 390.1604AlogP: 4.35#Rotatable Bonds: 4
Polar Surface Area: 95.59Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.38CX Basic pKa: 4.77CX LogP: 3.03CX LogD: 3.03
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.48Np Likeness Score: -1.80

References

1.  (2015)  Compounds that are ERK inhibitors, 

Source

Source(1):