The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9062048, 21 ID: ALA3704040
PubChem CID: 54770389
Max Phase: Preclinical
Molecular Formula: C23H30F3N5O3S
Molecular Weight: 513.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[S+]([O-])CC(O)[C@H]1CC[C@@H](N2CC(NC(=O)CNc3ncnc4ccc(C(F)(F)F)cc34)C2)CC1
Standard InChI: InChI=1S/C23H30F3N5O3S/c1-35(34)12-20(32)14-2-5-17(6-3-14)31-10-16(11-31)30-21(33)9-27-22-18-8-15(23(24,25)26)4-7-19(18)28-13-29-22/h4,7-8,13-14,16-17,20,32H,2-3,5-6,9-12H2,1H3,(H,30,33)(H,27,28,29)/t14-,17+,20?,35?
Standard InChI Key: YTGGTNHFYFYRQH-RIIUPOOCSA-N
Molfile:
RDKit 2D
35 38 0 0 1 0 0 0 0 0999 V2000
10.3892 -8.9817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7904 -8.6386 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.7883 -7.9486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0446 -9.0728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0472 -9.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6459 -10.2789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3013 -10.3702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3026 -11.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5563 -11.6653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8148 -11.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8072 -10.3725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5536 -9.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0011 -11.5257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6295 -12.3041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8791 -11.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2227 -11.1540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0648 -12.2086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4096 -11.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5368 -10.9687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5953 -11.9330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9400 -11.3713 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1258 -11.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9682 -12.5055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1550 -12.7931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5006 -12.2326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3431 -11.3845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9988 -10.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8413 -9.9760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0280 -9.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6276 -10.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4701 -11.0969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1296 -8.8398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3947 -8.3911 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.7802 -8.6099 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.2559 -8.1614 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
4 5 1 0
5 6 1 0
7 5 1 6
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 7 1 0
10 13 1 6
13 14 1 0
14 15 1 0
15 16 1 0
16 13 1 0
15 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 22 1 0
31 26 1 0
29 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
M CHG 2 2 1 3 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 513.59Molecular Weight (Monoisotopic): 513.2021AlogP: 2.16#Rotatable Bonds: 8Polar Surface Area: 113.44Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.42CX Basic pKa: 6.84CX LogP: 0.53CX LogD: 0.43Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.46Np Likeness Score: -1.09
References 1. (2015) Cyclohexyl-azetidinyl antagonists of CCR2,