The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9062048, 24 ID: ALA3704043
PubChem CID: 88547534
Max Phase: Preclinical
Molecular Formula: C25H25F6N5O2S
Molecular Weight: 573.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CNc1cc(C(F)(F)F)nc2ccc(C(F)(F)F)cc12)NC1CN([C@H]2CC[C@@](O)(c3nccs3)CC2)C1
Standard InChI: InChI=1S/C25H25F6N5O2S/c26-24(27,28)14-1-2-18-17(9-14)19(10-20(35-18)25(29,30)31)33-11-21(37)34-15-12-36(13-15)16-3-5-23(38,6-4-16)22-32-7-8-39-22/h1-2,7-10,15-16,38H,3-6,11-13H2,(H,33,35)(H,34,37)/t16-,23-
Standard InChI Key: RJTKUOABESXRDU-QXONSOMPSA-N
Molfile:
RDKit 2D
39 43 0 0 1 0 0 0 0 0999 V2000
14.2805 -4.8047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1583 -5.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4345 -3.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2959 -2.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8923 -3.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6046 -4.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7433 -5.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5926 -2.5235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2044 -1.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1437 -2.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3379 -5.8515 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.2596 -5.8505 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2984 -6.4508 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0388 3.6015 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.0394 3.6005 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.0006 4.2008 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.8515 -6.6781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8605 -7.7706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1114 -9.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6440 -8.7594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4861 -7.2677 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 2 1 0
5 8 1 6
8 9 1 0
9 10 1 0
10 11 1 0
11 8 1 0
10 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 17 1 0
26 21 1 0
24 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
19 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
2 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 573.56Molecular Weight (Monoisotopic): 573.1633AlogP: 4.77#Rotatable Bonds: 6Polar Surface Area: 90.38Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.13CX Basic pKa: 6.69CX LogP: 3.64CX LogD: 3.57Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.37Np Likeness Score: -1.10
References 1. (2015) Cyclohexyl-azetidinyl antagonists of CCR2,