The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9062048, 32 ID: ALA3704051
PubChem CID: 54770834
Max Phase: Preclinical
Molecular Formula: C27H38F3N5O2
Molecular Weight: 521.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCC(O)(CCC)[C@H]1CC[C@@H](N2CC(NC(=O)CNc3ncnc4ccc(C(F)(F)F)cc34)C2)CC1
Standard InChI: InChI=1S/C27H38F3N5O2/c1-3-11-26(37,12-4-2)18-5-8-21(9-6-18)35-15-20(16-35)34-24(36)14-31-25-22-13-19(27(28,29)30)7-10-23(22)32-17-33-25/h7,10,13,17-18,20-21,37H,3-6,8-9,11-12,14-16H2,1-2H3,(H,34,36)(H,31,32,33)/t18-,21+
Standard InChI Key: KHBXJLWHCNLVET-RVWIWJKTSA-N
Molfile:
RDKit 2D
37 40 0 0 1 0 0 0 0 0999 V2000
17.9851 -6.2887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8529 -6.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7136 -5.7093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2976 -6.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0762 -7.3860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4573 -7.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1792 -8.6794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0887 -9.4621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1583 -5.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4345 -3.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2959 -2.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8923 -3.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6046 -4.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7433 -5.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5926 -2.5235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2044 -1.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1437 -2.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3379 -5.8515 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.2596 -5.8505 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2984 -6.4508 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
4 6 1 0
6 7 1 0
7 8 1 0
9 4 1 1
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 9 1 0
12 15 1 1
15 16 1 0
16 17 1 0
17 18 1 0
18 15 1 0
17 19 1 0
19 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 24 1 0
33 28 1 0
31 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.63Molecular Weight (Monoisotopic): 521.2978AlogP: 4.75#Rotatable Bonds: 10Polar Surface Area: 90.38Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.59CX Basic pKa: 7.48CX LogP: 4.53CX LogD: 4.19Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.42Np Likeness Score: -1.01
References 1. (2015) Cyclohexyl-azetidinyl antagonists of CCR2,