The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9062048, 33 ID: ALA3704052
PubChem CID: 54771063
Max Phase: Preclinical
Molecular Formula: C25H32F3N5O
Molecular Weight: 475.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CNc1ncnc2ccc(C(F)(F)F)cc12)NC1CN([C@H]2CC[C@@H](C3CCCC3)CC2)C1
Standard InChI: InChI=1S/C25H32F3N5O/c26-25(27,28)18-7-10-22-21(11-18)24(31-15-30-22)29-12-23(34)32-19-13-33(14-19)20-8-5-17(6-9-20)16-3-1-2-4-16/h7,10-11,15-17,19-20H,1-6,8-9,12-14H2,(H,32,34)(H,29,30,31)/t17-,20+
Standard InChI Key: RRTPMDNEBIXFSP-MSEWRSJXSA-N
Molfile:
RDKit 2D
34 38 0 0 1 0 0 0 0 0999 V2000
3.6384 -0.9011 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5988 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5984 -2.7004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.6377 -2.1009 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6011 -3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9020 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9050 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8669 -5.8520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2059 -5.9988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2089 -7.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2696 -8.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2089 -9.5693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.1482 -8.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2088 -11.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3394 -12.0380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0631 -13.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6482 -14.0102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5095 -13.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7858 -11.5594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3717 -15.4853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0216 -16.1090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2168 -17.5963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6915 -17.8702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4078 -16.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 18 1 0
22 20 1 1
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 22 1 0
25 28 1 1
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 28 1 0
12 33 1 0
33 8 1 0
33 34 2 0
34 5 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.56Molecular Weight (Monoisotopic): 475.2559AlogP: 4.61#Rotatable Bonds: 6Polar Surface Area: 70.15Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.63CX Basic pKa: 7.65CX LogP: 4.42CX LogD: 3.97Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.64Np Likeness Score: -1.18
References 1. (2015) Cyclohexyl-azetidinyl antagonists of CCR2,