US9062048, 33

ID: ALA3704052

PubChem CID: 54771063

Max Phase: Preclinical

Molecular Formula: C25H32F3N5O

Molecular Weight: 475.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CNc1ncnc2ccc(C(F)(F)F)cc12)NC1CN([C@H]2CC[C@@H](C3CCCC3)CC2)C1

Standard InChI:  InChI=1S/C25H32F3N5O/c26-25(27,28)18-7-10-22-21(11-18)24(31-15-30-22)29-12-23(34)32-19-13-33(14-19)20-8-5-17(6-9-20)16-3-1-2-4-16/h7,10-11,15-17,19-20H,1-6,8-9,12-14H2,(H,32,34)(H,29,30,31)/t17-,20+

Standard InChI Key:  RRTPMDNEBIXFSP-MSEWRSJXSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  1  0  0  0  0  0999 V2000
    3.6384   -0.9011    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5988   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5984   -2.7004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.6377   -2.1009    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6011   -3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9020   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9050   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8669   -5.8520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2059   -5.9988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2089   -7.4996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2696   -8.5086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2089   -9.5693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1482   -8.5086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2088  -11.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3394  -12.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0631  -13.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6482  -14.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5095  -13.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7858  -11.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3717  -15.4853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0216  -16.1090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2168  -17.5963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6915  -17.8702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4078  -16.5523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  2  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 18  1  0
 22 20  1  1
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 22  1  0
 25 28  1  1
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 28  1  0
 12 33  1  0
 33  8  1  0
 33 34  2  0
 34  5  1  0
M  END

Associated Targets(Human)

CCRL2 Tchem C-C chemokine receptor-like 2 (177 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.56Molecular Weight (Monoisotopic): 475.2559AlogP: 4.61#Rotatable Bonds: 6
Polar Surface Area: 70.15Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.63CX Basic pKa: 7.65CX LogP: 4.42CX LogD: 3.97
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.64Np Likeness Score: -1.18

References

1.  (2015)  Cyclohexyl-azetidinyl antagonists of CCR2, 

Source

Source(1):