The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9062048, 34 ID: ALA3704053
PubChem CID: 54770835
Max Phase: Preclinical
Molecular Formula: C22H25F6N5O2
Molecular Weight: 505.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CNc1ncnc2ccc(C(F)(F)F)cc12)NC1CN([C@H]2CC[C@@H](C(O)C(F)(F)F)CC2)C1
Standard InChI: InChI=1S/C22H25F6N5O2/c23-21(24,25)13-3-6-17-16(7-13)20(31-11-30-17)29-8-18(34)32-14-9-33(10-14)15-4-1-12(2-5-15)19(35)22(26,27)28/h3,6-7,11-12,14-15,19,35H,1-2,4-5,8-10H2,(H,32,34)(H,29,30,31)/t12-,15+,19?
Standard InChI Key: UGPDICGCZGEZCD-ZHDLXYNCSA-N
Molfile:
RDKit 2D
35 38 0 0 1 0 0 0 0 0999 V2000
15.4282 -5.8126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2956 -6.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1583 -5.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4345 -3.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2959 -2.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8923 -3.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6046 -4.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7433 -5.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5926 -2.5235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2044 -1.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1437 -2.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3379 -5.8515 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.2596 -5.8505 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2984 -6.4508 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.0170 -7.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9264 -8.4667 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.7938 -8.8627 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.8844 -8.0800 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 1
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 3 1 0
6 9 1 1
9 10 1 0
10 11 1 0
11 12 1 0
12 9 1 0
11 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 18 1 0
27 22 1 0
25 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
2 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.46Molecular Weight (Monoisotopic): 505.1912AlogP: 3.34#Rotatable Bonds: 6Polar Surface Area: 90.38Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.26CX Basic pKa: 7.54CX LogP: 2.91CX LogD: 2.54Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.52Np Likeness Score: -1.11
References 1. (2015) Cyclohexyl-azetidinyl antagonists of CCR2,