The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9062048, 36 ID: ALA3704055
PubChem CID: 54771064
Max Phase: Preclinical
Molecular Formula: C23H28F3N5O
Molecular Weight: 447.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=C(C)[C@H]1CC[C@@H](N2CC(NC(=O)CNc3ncnc4ccc(C(F)(F)F)cc34)C2)CC1
Standard InChI: InChI=1S/C23H28F3N5O/c1-14(2)15-3-6-18(7-4-15)31-11-17(12-31)30-21(32)10-27-22-19-9-16(23(24,25)26)5-8-20(19)28-13-29-22/h5,8-9,13,15,17-18H,1,3-4,6-7,10-12H2,2H3,(H,30,32)(H,27,28,29)/t15-,18+
Standard InChI Key: GFEVAFQMSYEYIO-RHNCMZPLSA-N
Molfile:
RDKit 2D
32 35 0 0 1 0 0 0 0 0999 V2000
15.4282 -5.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2956 -6.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0729 -7.3881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1583 -5.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4345 -3.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2959 -2.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8923 -3.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6046 -4.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7433 -5.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5926 -2.5235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2044 -1.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1437 -2.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3379 -5.8515 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.2596 -5.8505 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2984 -6.4508 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
4 2 1 1
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 4 1 0
7 10 1 1
10 11 1 0
11 12 1 0
12 13 1 0
13 10 1 0
12 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 19 1 0
28 23 1 0
26 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.51Molecular Weight (Monoisotopic): 447.2246AlogP: 4.00#Rotatable Bonds: 6Polar Surface Area: 70.15Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.70CX Basic pKa: 7.71CX LogP: 3.64CX LogD: 3.16Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.66Np Likeness Score: -1.09
References 1. (2015) Cyclohexyl-azetidinyl antagonists of CCR2,