US9062048, 48

ID: ALA3704061

PubChem CID: 54771298

Max Phase: Preclinical

Molecular Formula: C25H33F3N6O2

Molecular Weight: 506.57

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C(=O)N(C)[C@H]1CC[C@@H](N2CC(NC(=O)CNc3ncnc4ccc(C(F)(F)F)cc34)C2)CC1

Standard InChI:  InChI=1S/C25H33F3N6O2/c1-15(2)24(36)33(3)18-5-7-19(8-6-18)34-12-17(13-34)32-22(35)11-29-23-20-10-16(25(26,27)28)4-9-21(20)30-14-31-23/h4,9-10,14-15,17-19H,5-8,11-13H2,1-3H3,(H,32,35)(H,29,30,31)/t18-,19+

Standard InChI Key:  YTMRPGATDQWWBC-KDURUIRLSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  1  0  0  0  0  0999 V2000
   14.9316   -9.8421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1543   -8.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2870   -8.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0170   -7.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8844   -8.0800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2956   -6.2089    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4282   -5.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1583   -5.2296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4345   -3.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2959   -2.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8923   -3.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6046   -4.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7433   -5.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5926   -2.5235    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2044   -1.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8003   -1.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1437   -2.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4990   -0.7409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2024   -2.6932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -5.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3379   -5.8515    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2596   -5.8505    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2984   -6.4508    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  8  6  1  1
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  8  1  0
 11 14  1  1
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 14  1  0
 16 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 23  1  0
 32 27  1  0
 30 33  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
M  END

Associated Targets(Human)

CCRL2 Tchem C-C chemokine receptor-like 2 (177 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.57Molecular Weight (Monoisotopic): 506.2617AlogP: 3.29#Rotatable Bonds: 7
Polar Surface Area: 90.46Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.55CX Basic pKa: 7.35CX LogP: 2.76CX LogD: 2.49
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.60Np Likeness Score: -1.54

References

1.  (2015)  Cyclohexyl-azetidinyl antagonists of CCR2, 

Source

Source(1):