The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9062048, 43 ID: ALA3704062
PubChem CID: 58562503
Max Phase: Preclinical
Molecular Formula: C21H27F3N6O
Molecular Weight: 436.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN[C@H]1CC[C@@H](N2CC(NC(=O)CNc3ncnc4ccc(C(F)(F)F)cc34)C2)CC1
Standard InChI: InChI=1S/C21H27F3N6O/c1-25-14-3-5-16(6-4-14)30-10-15(11-30)29-19(31)9-26-20-17-8-13(21(22,23)24)2-7-18(17)27-12-28-20/h2,7-8,12,14-16,25H,3-6,9-11H2,1H3,(H,29,31)(H,26,27,28)/t14-,16+
Standard InChI Key: FZYHDASLGVWZGX-FZNQNYSPSA-N
Molfile:
RDKit 2D
31 34 0 0 1 0 0 0 0 0999 V2000
14.0729 -7.3881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2956 -6.2089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1583 -5.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4345 -3.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2959 -2.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8923 -3.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6046 -4.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7433 -5.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5926 -2.5235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2044 -1.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1437 -2.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3379 -5.8515 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.2596 -5.8505 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2984 -6.4508 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 1
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 3 1 0
6 9 1 1
9 10 1 0
10 11 1 0
11 12 1 0
12 9 1 0
11 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 18 1 0
27 22 1 0
25 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.48Molecular Weight (Monoisotopic): 436.2198AlogP: 2.39#Rotatable Bonds: 6Polar Surface Area: 82.18Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.65CX Basic pKa: 10.70CX LogP: 1.91CX LogD: -1.52Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.65Np Likeness Score: -1.35
References 1. (2015) Cyclohexyl-azetidinyl antagonists of CCR2,