The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9115102, Ex2 ID: ALA3704903
PubChem CID: 51029815
Max Phase: Preclinical
Molecular Formula: C19H26N4O6S
Molecular Weight: 438.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC#CCOc1ccc(C(=O)NC[C@@H](C(=O)NO)N2CCN(S(C)(=O)=O)CC2)cc1
Standard InChI: InChI=1S/C19H26N4O6S/c1-3-4-13-29-16-7-5-15(6-8-16)18(24)20-14-17(19(25)21-26)22-9-11-23(12-10-22)30(2,27)28/h5-8,17,26H,9-14H2,1-2H3,(H,20,24)(H,21,25)/t17-/m0/s1
Standard InChI Key: GHBQSNPRMVUGFE-KRWDZBQOSA-N
Molfile:
RDKit 2D
30 31 0 0 1 0 0 0 0 0999 V2000
6.2295 -5.1122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1915 -4.5101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6024 2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 0.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8003 1.4887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.0994 0.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3984 1.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3985 2.9886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.0995 3.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8004 2.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6983 3.7390 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-12.7379 3.1397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-11.6979 4.9390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.7372 4.3395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4995 -0.7599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4602 -1.3599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7990 -1.5107 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.7994 -2.7107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 3 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
9 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
16 15 1 1
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 17 1 0
20 23 1 0
23 24 2 0
23 25 2 0
23 26 1 0
16 27 1 0
27 28 2 0
27 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.51Molecular Weight (Monoisotopic): 438.1573AlogP: -0.73#Rotatable Bonds: 8Polar Surface Area: 128.28Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.71CX Basic pKa: 3.67CX LogP: -0.58CX LogD: -0.60Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.28Np Likeness Score: -1.15
References 1. (2015) N-[2-hydroxycarbamoyl-2-(piperazinyl) ethyl] benzamide compounds, their preparation and their use as TACE inhibitors,