The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9115102, Ex14::US9115102, Ex24 ID: ALA3704910
PubChem CID: 51029992
Max Phase: Preclinical
Molecular Formula: C26H31N5O6S
Molecular Weight: 541.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(COc2ccc(C(=O)NC[C@@H](C(=O)NO)N3CCN(S(C)(=O)=O)CC3)cc2)c2ccccc2n1
Standard InChI: InChI=1S/C26H31N5O6S/c1-18-15-20(22-5-3-4-6-23(22)28-18)17-37-21-9-7-19(8-10-21)25(32)27-16-24(26(33)29-34)30-11-13-31(14-12-30)38(2,35)36/h3-10,15,24,34H,11-14,16-17H2,1-2H3,(H,27,32)(H,29,33)/t24-/m0/s1
Standard InChI Key: PNRXTCCMSJTZGK-DEOSSOPVSA-N
Molfile:
RDKit 2D
38 41 0 0 1 0 0 0 0 0999 V2000
2.3383 -1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6060 6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6060 7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 8.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0079 7.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0079 6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 9.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3421 10.3529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 10.4997 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0001 12.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3007 12.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3038 14.2500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6028 15.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6028 16.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3038 17.2501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0048 16.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0047 15.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3038 18.7509 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.3427 19.3515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2644 19.3506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3032 19.9509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6007 11.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6008 10.7992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9007 12.7492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9402 12.1495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
17 16 1 1
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 18 1 0
21 24 1 0
24 25 2 0
24 26 2 0
24 27 1 0
17 28 1 0
28 29 2 0
28 30 1 0
30 31 1 0
4 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 32 1 0
37 38 2 0
38 2 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 541.63Molecular Weight (Monoisotopic): 541.1995AlogP: 1.30#Rotatable Bonds: 9Polar Surface Area: 141.17Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.71CX Basic pKa: 5.02CX LogP: 0.37CX LogD: 0.35Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -1.36
References 1. (2015) N-[2-hydroxycarbamoyl-2-(piperazinyl) ethyl] benzamide compounds, their preparation and their use as TACE inhibitors,