The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9115102, Ex27 ID: ALA3704919
PubChem CID: 75600335
Max Phase: Preclinical
Molecular Formula: C30H31F3N6O4
Molecular Weight: 596.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCC(C(=O)NO)N1CCN(Cc2ccccc2)CC1)c1ccc(OCc2c(C(F)(F)F)nn3ccccc23)cc1
Standard InChI: InChI=1S/C30H31F3N6O4/c31-30(32,33)27-24(25-8-4-5-13-39(25)35-27)20-43-23-11-9-22(10-12-23)28(40)34-18-26(29(41)36-42)38-16-14-37(15-17-38)19-21-6-2-1-3-7-21/h1-13,26,42H,14-20H2,(H,34,40)(H,36,41)
Standard InChI Key: PWHWIWBGOFSUOR-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
-7.9984 -6.7685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.6321 -7.9113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.6400 -9.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8129 -8.7695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.1819 -10.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7144 -10.7668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7077 -9.6537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2401 -9.9681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8715 -11.1101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2334 -8.8550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7662 -9.1671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7624 -8.0525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2256 -6.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2234 -5.5086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6890 -4.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5524 -4.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9530 -5.4604 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.7524 -4.4204 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.1529 -5.4597 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.6928 -6.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6967 -7.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1886 -11.5656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.6558 -11.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6597 -12.3680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.1965 -13.7947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-12.1986 -14.9119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.7331 -16.3387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.7331 -17.4568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.2649 -18.8819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.7966 -19.1889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.7966 -18.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.2648 -16.6459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.7293 -14.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7254 -12.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 16 2 0
24 19 1 0
17 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
13 29 1 0
29 30 2 0
30 10 1 0
5 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
34 42 1 0
42 43 1 0
43 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 596.61Molecular Weight (Monoisotopic): 596.2359AlogP: 3.35#Rotatable Bonds: 10Polar Surface Area: 111.44Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.71CX Basic pKa: 7.07CX LogP: 3.75CX LogD: 3.69Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.19Np Likeness Score: -1.34
References 1. (2015) N-[2-hydroxycarbamoyl-2-(piperazinyl) ethyl] benzamide compounds, their preparation and their use as TACE inhibitors,