The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[2-amino-4-{3-[5-(6-amino-9H-9-purinyl)-3,4-dihydroxytetrahydro-2-furanyl]-3-hydroxypropylsulfanyl}butanoic acid]phosphonoamidodiphosphoric acid ID: ALA3706404
PubChem CID: 122197258
Max Phase: Preclinical
Molecular Formula: C16H28N7O14P3S
Molecular Weight: 667.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1ncn2[C@@H]1O[C@H]([C@@H](CCSCCC(N)C(=O)O)OP(=O)(O)OP(=O)(O)NP(=O)(O)O)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C16H28N7O14P3S/c17-7(16(26)27)1-3-41-4-2-8(36-40(33,34)37-39(31,32)22-38(28,29)30)12-10(24)11(25)15(35-12)23-6-21-9-13(18)19-5-20-14(9)23/h5-8,10-12,15,24-25H,1-4,17H2,(H,26,27)(H,33,34)(H2,18,19,20)(H4,22,28,29,30,31,32)/t7?,8-,10+,11-,12-,15-/m1/s1
Standard InChI Key: YSQBQFZXWAVDTE-GIWIQNKBSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
2.8232 -1.3613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0027 -1.2751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1259 -3.2026 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
3.3752 -0.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1289 -1.0838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0426 -1.9043 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5902 -0.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6970 -3.2026 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
1.4507 -1.8882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8404 -2.7901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2357 -2.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6970 -1.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4115 -3.6151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7832 -0.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5549 -3.2026 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-0.0175 -1.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7963 -0.5989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2890 0.0723 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0175 -2.7901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7101 0.2216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.0188 -1.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5384 -3.9171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9564 0.5572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2845 -3.9171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1424 -3.9171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7134 -2.4882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7332 -1.9651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1095 -2.4882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9258 0.1931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3043 -1.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9674 -2.4882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2693 -3.6151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1701 -0.1801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5500 -0.9344 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7320 -1.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0188 -0.7276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3043 -2.7901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1609 -1.5526 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.5898 -1.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4464 -1.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8754 -1.9651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7402 -2.3765 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 6
3 13 1 0
4 1 1 0
5 4 2 0
6 11 2 0
7 2 1 0
8 19 1 0
9 2 1 0
10 3 1 0
11 1 1 0
12 9 1 0
13 8 1 0
14 7 1 0
15 10 1 0
12 16 1 0
17 5 1 0
18 4 1 0
16 19 1 6
20 23 1 0
21 30 1 0
22 3 2 0
23 18 2 0
24 8 2 0
25 15 2 0
26 3 1 0
27 21 2 0
28 8 1 0
7 29 1 1
30 39 1 0
31 15 1 0
32 15 1 0
14 33 1 1
34 17 1 0
35 16 1 0
36 21 1 0
37 30 1 0
38 40 1 0
39 41 1 0
40 35 1 0
41 38 1 0
5 6 1 0
14 12 1 0
20 17 2 0
12 42 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 667.42Molecular Weight (Monoisotopic): 667.0628AlogP: -1.76#Rotatable Bonds: 15Polar Surface Area: 345.25Molecular Species: ZWITTERIONHBA: 16HBD: 10#RO5 Violations: 3HBA (Lipinski): 21HBD (Lipinski): 12#RO5 Violations (Lipinski): 3CX Acidic pKa: 0.32CX Basic pKa: 9.50CX LogP: -7.68CX LogD: -14.92Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.07Np Likeness Score: 0.87
References 1. Vrudhula VM, Kappler F, Afshar C, Ginell SL, Lessinger L, Hampton A.. (1989) Approaches to isozyme-specific inhibitors. 16. A novel methyl-C5' covalent adduct of L-ethionine and beta,gamma-imido-ATP as a potent multisubstrate inhibitor of rat methionine adenosyltransferases., 32 (4): [PMID:2784835 ] [10.1021/jm00124a026 ]