[2-amino-4-{3-[5-(6-amino-9H-9-purinyl)-3,4-dihydroxytetrahydro-2-furanyl]-3-hydroxypropylsulfanyl}butanoic acid]phosphonoamidodiphosphoric acid

ID: ALA3706405

PubChem CID: 122197259

Max Phase: Preclinical

Molecular Formula: C16H28N7O14P3S

Molecular Weight: 667.42

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ncnc2c1ncn2[C@@H]1O[C@H]([C@H](CCSCCC(N)C(=O)O)OP(=O)(O)OP(=O)(O)NP(=O)(O)O)[C@@H](O)[C@H]1O

Standard InChI:  InChI=1S/C16H28N7O14P3S/c17-7(16(26)27)1-3-41-4-2-8(36-40(33,34)37-39(31,32)22-38(28,29)30)12-10(24)11(25)15(35-12)23-6-21-9-13(18)19-5-20-14(9)23/h5-8,10-12,15,24-25H,1-4,17H2,(H,26,27)(H,33,34)(H2,18,19,20)(H4,22,28,29,30,31,32)/t7?,8-,10-,11+,12+,15+/m0/s1

Standard InChI Key:  YSQBQFZXWAVDTE-AZHGDPIHSA-N

Molfile:  

     RDKit          2D

 42 44  0  0  0  0  0  0  0  0999 V2000
    4.6446    0.3350    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8241    0.4212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9473   -1.5063    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    5.1966    0.9481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9503    0.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8641   -0.2080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4116    1.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5184   -1.5063    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    3.2721   -0.1919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6618   -1.0938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0571   -0.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5184    0.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2329   -1.9188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6046    0.9642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3763   -1.5063    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    1.8039   -0.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6177    1.0975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1104    1.7686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8039   -1.0938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5315    1.9179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1974    0.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3598   -2.2208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7778    2.2535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1059   -2.2208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9638   -2.2208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5348   -0.7918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9118   -0.2688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9309   -0.7918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7472    1.8894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4829   -0.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7888   -0.7918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0908   -1.9188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9915    1.5162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3714    0.7619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0895    0.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1974    0.9687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4829   -1.0938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3395    0.1437    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7684    0.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3750   -0.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0540   -0.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5616   -0.6802    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  3 13  1  0
  4  1  1  0
  5  4  2  0
  6 11  2  0
  7  2  1  0
  8 19  1  0
  9  2  1  0
 10  3  1  0
 11  1  1  0
 12  9  1  0
 13  8  1  0
 14  7  1  0
 15 10  1  0
 12 16  1  0
 17  5  1  0
 18  4  1  0
 16 19  1  1
 20 23  1  0
 21 30  1  0
 22  3  2  0
 23 18  2  0
 24  8  2  0
 25 15  2  0
 26  3  1  0
 27 21  2  0
 28  8  1  0
  7 29  1  1
 30 39  1  0
 31 15  1  0
 32 15  1  0
 14 33  1  1
 34 17  1  0
 35 16  1  0
 36 21  1  0
 37 30  1  0
 38 40  1  0
 39 41  1  0
 40 35  1  0
 41 38  1  0
  5  6  1  0
 14 12  1  0
 20 17  2  0
 12 42  1  1
M  END

Alternative Forms

  1. Parent:

    ALA3706405

    ---

Associated Targets(non-human)

Mat1a S-adenosylmethionine synthetase (MAT 1 and MAT 2) (155 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 667.42Molecular Weight (Monoisotopic): 667.0628AlogP: -1.76#Rotatable Bonds: 15
Polar Surface Area: 345.25Molecular Species: ZWITTERIONHBA: 16HBD: 10
#RO5 Violations: 3HBA (Lipinski): 21HBD (Lipinski): 12#RO5 Violations (Lipinski): 3
CX Acidic pKa: 0.32CX Basic pKa: 9.50CX LogP: -7.68CX LogD: -14.92
Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.07Np Likeness Score: 0.87

References

1. Vrudhula VM, Kappler F, Afshar C, Ginell SL, Lessinger L, Hampton A..  (1989)  Approaches to isozyme-specific inhibitors. 16. A novel methyl-C5' covalent adduct of L-ethionine and beta,gamma-imido-ATP as a potent multisubstrate inhibitor of rat methionine adenosyltransferases.,  32  (4): [PMID:2784835] [10.1021/jm00124a026]

Source