The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-[2-Amino-2-(carboxymethyl-carbamoyl)-ethylsulfanyl]-9-(3-hexyloxy-phenyl)-5-hydroxy-non-7-enoic acid ID: ALA3706608
PubChem CID: 122197297
Max Phase: Preclinical
Molecular Formula: C26H40N2O7S
Molecular Weight: 524.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCOc1cccc(C/C=C/[C@H](SC[C@H](N)C(=O)NCC(=O)O)[C@H](O)CCCC(=O)O)c1
Standard InChI: InChI=1S/C26H40N2O7S/c1-2-3-4-5-15-35-20-11-6-9-19(16-20)10-7-13-23(22(29)12-8-14-24(30)31)36-18-21(27)26(34)28-17-25(32)33/h6-7,9,11,13,16,21-23,29H,2-5,8,10,12,14-15,17-18,27H2,1H3,(H,28,34)(H,30,31)(H,32,33)/b13-7+/t21-,22+,23-/m0/s1
Standard InChI Key: RYSYWWLALYEJEN-HTACPVTASA-N
Molfile:
RDKit 2D
36 36 0 0 1 0 0 0 0 0999 V2000
3.7500 -6.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -6.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -5.3542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7500 -7.8292 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.0417 -4.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3250 -9.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4625 -7.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -8.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0375 -6.5917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0375 -9.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -3.7042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3250 -9.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7500 -8.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0417 -4.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1792 -6.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -9.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1750 -9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3292 -3.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0417 -8.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5375 -8.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -8.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -9.8917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2500 -9.0750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 -9.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6042 -8.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8917 -9.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1750 -7.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1792 -8.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5375 -7.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -7.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2500 -9.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9708 -10.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6833 -12.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6833 -11.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9708 -11.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3958 -12.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 7 1 0
5 14 1 0
6 25 1 0
7 2 1 0
8 10 2 0
9 1 2 0
10 13 1 0
11 5 2 0
12 6 2 0
13 4 1 6
14 3 1 0
2 15 1 1
16 13 1 0
17 21 2 0
18 5 1 0
19 6 1 0
20 17 1 0
21 24 1 0
16 22 1 1
23 20 1 0
24 8 1 0
25 26 1 0
26 28 1 0
27 30 2 0
28 16 1 0
29 27 1 0
30 21 1 0
31 23 1 0
32 31 1 0
33 34 1 0
34 35 1 0
35 32 1 0
36 33 1 0
29 20 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.68Molecular Weight (Monoisotopic): 524.2556AlogP: 2.99#Rotatable Bonds: 20Polar Surface Area: 159.18Molecular Species: ACIDHBA: 7HBD: 5#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.59CX Basic pKa: 8.05CX LogP: 0.59CX LogD: -2.27Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.13Np Likeness Score: 0.58
References 1. Bernstein PR, Snyder DW, Adams EJ, Krell RD, Vacek EP, Willard AK.. (1986) Chemically stable homocinnamyl analogues of the leukotrienes: synthesis and preliminary biological evaluation., 29 (12): [PMID:2878081 ] [10.1021/jm00162a010 ]