(4R,5S,6E)-5-[2-Amino-2-(carboxymethyl-carbamoyl)-ethylsulfanyl]-4-hydroxy-nonadec-6-enoic acid. 7/8H2O

ID: ALA3707134

PubChem CID: 101613123

Max Phase: Preclinical

Molecular Formula: C24H44N2O6S

Molecular Weight: 488.69

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCC/C=C/[C@H](SC[C@H](N)C(=O)NCC(=O)O)[C@@H](O)CCC(=O)O

Standard InChI:  InChI=1S/C24H44N2O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-21(20(27)15-16-22(28)29)33-18-19(25)24(32)26-17-23(30)31/h13-14,19-21,27H,2-12,15-18,25H2,1H3,(H,26,32)(H,28,29)(H,30,31)/b14-13+/t19-,20-,21-/m0/s1

Standard InChI Key:  GAXVUDYIUJUDBE-XHTVIRLASA-N

Molfile:  

     RDKit          2D

 33 32  0  0  1  0  0  0  0  0999 V2000
   12.5154   -4.1110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0236   -4.7734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3349   -4.2056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7124   -5.3412    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.6462   -3.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5980   -3.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2041   -4.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1876   -3.3539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1063   -4.2056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1379   -2.9753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8928   -5.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4011   -5.9090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8267   -3.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5815   -5.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7454   -4.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3515   -5.5305    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5650   -4.4895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4176   -3.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9740   -4.3949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2702   -2.7861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0567   -3.8271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0898   -6.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4176   -7.2339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2702  -13.5744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7620  -12.9119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7620   -9.3158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0898  -10.0729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5980  -10.7353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9259  -11.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4341  -12.1548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9259   -7.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2537   -8.6534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5980  -14.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  7  1  0
  5 13  1  0
  6 18  1  0
  7  2  1  0
  8  1  2  0
  9  6  2  0
 10  5  2  0
 11  4  1  1
 12 11  1  0
 13  3  1  0
 14 12  2  0
 15 17  1  0
  2 16  1  1
 17 11  1  0
 18 15  1  0
 19  5  1  0
 20  6  1  0
 17 21  1  6
 22 14  1  0
 23 22  1  0
 24 25  1  0
 25 30  1  0
 26 32  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 31 23  1  0
 32 31  1  0
 33 24  1  0
M  END

Associated Targets(non-human)

Cavia porcellus (23802 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.69Molecular Weight (Monoisotopic): 488.2920AlogP: 3.71#Rotatable Bonds: 22
Polar Surface Area: 149.95Molecular Species: ACIDHBA: 6HBD: 5
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.58CX Basic pKa: 8.05CX LogP: 1.38CX LogD: -1.51
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.11Np Likeness Score: 0.93

References

1. Ku TW, McCarthy ME, Weichman BM, Gleason JG..  (1985)  Synthesis and LTD4 antagonist activity of 2-norleukotriene analogues.,  28  (12): [PMID:4068008] [10.1021/jm00150a016]

Source