The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-Chlorophenyl)-2-{[(4-phenoxyphenyl)acetyl]amino)indan-2-carboxylic acid ID: ALA3714772
PubChem CID: 59335757
Max Phase: Preclinical
Molecular Formula: C30H24ClNO4
Molecular Weight: 497.98
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1ccc(Oc2ccccc2)cc1)NC1(C(=O)O)Cc2ccc(-c3ccc(Cl)cc3)cc2C1
Standard InChI: InChI=1S/C30H24ClNO4/c31-25-12-10-21(11-13-25)22-8-9-23-18-30(29(34)35,19-24(23)17-22)32-28(33)16-20-6-14-27(15-7-20)36-26-4-2-1-3-5-26/h1-15,17H,16,18-19H2,(H,32,33)(H,34,35)
Standard InChI Key: XUEPTCFLWHKSOL-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 -1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6203 -2.9951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9210 -3.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2184 -2.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2150 -1.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9143 -0.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2590 -3.5870 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.3026 1.3234 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3218 -1.2767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7288 -2.3200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5217 -1.2689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5434 2.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2841 3.9233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3434 2.6094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5249 5.2179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2633 6.5236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5019 7.8159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0019 7.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2635 6.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0249 5.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2374 9.0942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2633 9.0788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0293 10.3685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5292 10.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2632 9.0419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4973 7.7522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9974 7.7706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
2 10 1 0
13 16 1 0
8 17 1 0
8 18 1 0
18 19 1 0
18 20 2 0
17 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.98Molecular Weight (Monoisotopic): 497.1394AlogP: 6.08#Rotatable Bonds: 7Polar Surface Area: 75.63Molecular Species: ACIDHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.67CX Basic pKa: ┄CX LogP: 6.60CX LogD: 3.28Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.32Np Likeness Score: -0.58
References 1. (2010) Regulating agent of GPR34 receptor function,