The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(([4-(1,3-Benzothiazol-2-yloxy)phenyl]acetyl}amino)-5-(4-chlorophenyl)indan-2-carboxylic acid ID: ALA3714979
PubChem CID: 59335898
Max Phase: Preclinical
Molecular Formula: C31H23ClN2O4S
Molecular Weight: 555.06
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1ccc(Oc2nc3ccccc3s2)cc1)NC1(C(=O)O)Cc2ccc(-c3ccc(Cl)cc3)cc2C1
Standard InChI: InChI=1S/C31H23ClN2O4S/c32-24-11-9-20(10-12-24)21-7-8-22-17-31(29(36)37,18-23(22)16-21)34-28(35)15-19-5-13-25(14-6-19)38-30-33-26-3-1-2-4-27(26)39-30/h1-14,16H,15,17-18H2,(H,34,35)(H,36,37)
Standard InChI Key: GIAKLBQGJQRBJJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 -1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6203 -2.9951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9210 -3.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2184 -2.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2150 -1.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9143 -0.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2590 -3.5870 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.3026 1.3234 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3218 -1.2767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7288 -2.3200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5217 -1.2689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5434 2.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2841 3.9233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3434 2.6094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5249 5.2179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2633 6.5236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5019 7.8159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0019 7.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2635 6.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0249 5.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2374 9.0942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2633 9.0788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1208 10.2634 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.1145 7.8568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5378 8.3089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5417 9.8039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8381 10.5663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1488 9.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1449 8.3021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8302 7.5398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
2 10 1 0
13 16 1 0
8 17 1 0
8 18 1 0
18 19 1 0
18 20 2 0
17 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 1 0
31 32 1 0
32 35 1 0
34 33 1 0
33 31 2 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.06Molecular Weight (Monoisotopic): 554.1067AlogP: 6.69#Rotatable Bonds: 7Polar Surface Area: 88.52Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.66CX Basic pKa: ┄CX LogP: 7.42CX LogD: 4.10Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.23Np Likeness Score: -1.02
References 1. (2010) Regulating agent of GPR34 receptor function,