The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
O-Benzyl-N-alpha-{[6-(4-chlorophenyl)imidazo[1,2-a]pyridin-2-yl]carbonyl}-N-(methylsulfonyl)tyrosinamide ID: ALA3715433
PubChem CID: 59335692
Max Phase: Preclinical
Molecular Formula: C31H27ClN4O5S
Molecular Weight: 603.10
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)NC(=O)C(Cc1ccc(OCc2ccccc2)cc1)NC(=O)c1cn2cc(-c3ccc(Cl)cc3)ccc2n1
Standard InChI: InChI=1S/C31H27ClN4O5S/c1-42(39,40)35-31(38)27(17-21-7-14-26(15-8-21)41-20-22-5-3-2-4-6-22)34-30(37)28-19-36-18-24(11-16-29(36)33-28)23-9-12-25(32)13-10-23/h2-16,18-19,27H,17,20H2,1H3,(H,34,37)(H,35,38)
Standard InChI Key: MWESQRARTGLRGI-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
10.5623 -1.1693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3624 -1.1868 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.9776 -2.2171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7008 -0.9930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8208 1.3475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3215 1.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0552 2.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0916 0.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5072 -0.9685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5923 0.1014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5559 2.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2911 4.0047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7910 4.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5558 2.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8207 1.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3208 1.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0566 2.7456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8199 1.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3207 1.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0856 0.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5855 0.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3206 1.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5558 2.7921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0559 2.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 -1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6203 -2.9951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9210 -3.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2184 -2.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2150 -1.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9143 -0.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2590 -3.5870 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.7779 -2.2348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 7 2 0
5 6 2 0
6 9 1 0
8 7 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 2 0
11 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
16 18 1 0
18 19 2 0
18 20 1 0
17 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
5 35 1 0
38 41 1 0
20 2 1 0
2 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 603.10Molecular Weight (Monoisotopic): 602.1391AlogP: 4.65#Rotatable Bonds: 10Polar Surface Area: 118.87Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.97CX Basic pKa: 3.18CX LogP: 4.03CX LogD: 3.48Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.24Np Likeness Score: -1.19
References 1. (2010) Regulating agent of GPR34 receptor function,