The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-{[6-(4-Chlorophenyl)-1-benzofuran-2-yl]carbonyl}-O-(4-fluorobenzyl)tyrosine ID: ALA3715460
PubChem CID: 59335719
Max Phase: Preclinical
Molecular Formula: C31H23ClFNO5
Molecular Weight: 543.98
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC(Cc1ccc(OCc2ccc(F)cc2)cc1)C(=O)O)c1cc2ccc(-c3ccc(Cl)cc3)cc2o1
Standard InChI: InChI=1S/C31H23ClFNO5/c32-24-9-7-21(8-10-24)22-5-6-23-17-29(39-28(23)16-22)30(35)34-27(31(36)37)15-19-3-13-26(14-4-19)38-18-20-1-11-25(33)12-2-20/h1-14,16-17,27H,15,18H2,(H,34,35)(H,36,37)
Standard InChI Key: FGALGFUODDWEFL-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 -1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6203 -2.9951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9210 -3.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2184 -2.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2150 -1.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9143 -0.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2590 -3.5870 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7008 -0.9930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8208 1.3475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3215 1.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0916 0.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5072 -0.9685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2915 0.0970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0552 2.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5559 2.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2911 4.0047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7910 4.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5558 2.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8207 1.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3208 1.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0566 2.7456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8199 1.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3207 1.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0856 0.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5855 0.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3206 1.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5558 2.7921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0559 2.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5205 1.5154 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
2 10 1 0
13 16 1 0
8 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
20 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
36 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 543.98Molecular Weight (Monoisotopic): 543.1249AlogP: 6.90#Rotatable Bonds: 9Polar Surface Area: 88.77Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.18CX Basic pKa: ┄CX LogP: 6.79CX LogD: 3.75Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.21Np Likeness Score: -0.76
References 1. (2010) Regulating agent of GPR34 receptor function,